C24H26FN5O5 — CID 72946002
11-(2-fluoro-3,5-dimethoxyphenyl)-4-(3-hydroxypiperidine-1-carbonyl)-13-methyl-5,7,11,13-tetrazatricyclo[7.4.0.02,6]trideca-1,3,6,8-tetraen-12-one (PubChem CID 72946002) has the molecular formula C24H26FN5O5 and a molecular weight of 483.50 g/mol. Its IUPAC name is 11-(2-fluoro-3,5-dimethoxyphenyl)-4-(3-hydroxypiperidine-1-carbonyl)-13-methyl-5,7,11,13-tetrazatricyclo[7.4.0.02,6]trideca-1,3,6,8-tetraen-12-one.
| Compound Name | 11-(2-fluoro-3,5-dimethoxyphenyl)-4-(3-hydroxypiperidine-1-carbonyl)-13-methyl-5,7,11,13-tetrazatricyclo[7.4.0.02,6]trideca-1,3,6,8-tetraen-12-one |
|---|---|
| PubChem CID | 72946002 |
| Molecular Formula | C24H26FN5O5 |
| Molecular Weight | 483.50 g/mol |
| Exact Mass | 483.19 |
| IUPAC Name | 11-(2-fluoro-3,5-dimethoxyphenyl)-4-(3-hydroxypiperidine-1-carbonyl)-13-methyl-5,7,11,13-tetrazatricyclo[7.4.0.02,6]trideca-1,3,6,8-tetraen-12-one |
| SMILES | COc1cc(OC)c(F)c(N2Cc3cnc4[nH]c(C(=O)N5CCCC(O)C5)cc4c3N(C)C2=O)c1 |
| InChI | InChI=1S/C24H26FN5O5/c1-28-21-13(11-30(24(28)33)18-7-15(34-2)8-19(35-3)20(18)25)10-26-22-16(21)9-17(27-22)23(32)29-6-4-5-14(31)12-29/h7-10,14,31H,4-6,11-12H2,1-3H3,(H,26,27) |
| InChIKey | YVNRREHUQLAIJP-UHFFFAOYSA-N |
| XLogP | 2.89 |
| TPSA | 111.23 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 483.50 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |