C21H21F2N5O4 — CID 72946189
11-(2,6-difluoro-3,5-dimethoxyphenyl)-N,N,13-trimethyl-12-oxo-5,7,11,13-tetrazatricyclo[7.4.0.02,6]trideca-1,3,6,8-tetraene-4-carboxamide (PubChem CID 72946189) has the molecular formula C21H21F2N5O4 and a molecular weight of 445.43 g/mol. Its IUPAC name is 11-(2,6-difluoro-3,5-dimethoxyphenyl)-N,N,13-trimethyl-12-oxo-5,7,11,13-tetrazatricyclo[7.4.0.02,6]trideca-1,3,6,8-tetraene-4-carboxamide.
| Compound Name | 11-(2,6-difluoro-3,5-dimethoxyphenyl)-N,N,13-trimethyl-12-oxo-5,7,11,13-tetrazatricyclo[7.4.0.02,6]trideca-1,3,6,8-tetraene-4-carboxamide |
|---|---|
| PubChem CID | 72946189 |
| Molecular Formula | C21H21F2N5O4 |
| Molecular Weight | 445.43 g/mol |
| Exact Mass | 445.16 |
| IUPAC Name | 11-(2,6-difluoro-3,5-dimethoxyphenyl)-N,N,13-trimethyl-12-oxo-5,7,11,13-tetrazatricyclo[7.4.0.02,6]trideca-1,3,6,8-tetraene-4-carboxamide |
| SMILES | COc1cc(OC)c(F)c(N2Cc3cnc4[nH]c(C(=O)N(C)C)cc4c3N(C)C2=O)c1F |
| InChI | InChI=1S/C21H21F2N5O4/c1-26(2)20(29)12-6-11-17-10(8-24-19(11)25-12)9-28(21(30)27(17)3)18-15(22)13(31-4)7-14(32-5)16(18)23/h6-8H,9H2,1-5H3,(H,24,25) |
| InChIKey | NPSZJJIMEFKICH-UHFFFAOYSA-N |
| XLogP | 3.14 |
| TPSA | 91.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.43 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |