C26H26FN5O2 — CID 72946452
4-(4-fluorophenyl)-N,N-dimethyl-3-[2-(4-morpholin-4-ylanilino)-4-pyridinyl]-1,2-oxazol-5-amine (PubChem CID 72946452) has the molecular formula C26H26FN5O2 and a molecular weight of 459.53 g/mol. Its IUPAC name is 4-(4-fluorophenyl)-N,N-dimethyl-3-[2-(4-morpholin-4-ylanilino)-4-pyridinyl]-1,2-oxazol-5-amine.
| Compound Name | 4-(4-fluorophenyl)-N,N-dimethyl-3-[2-(4-morpholin-4-ylanilino)-4-pyridinyl]-1,2-oxazol-5-amine |
|---|---|
| PubChem CID | 72946452 |
| Molecular Formula | C26H26FN5O2 |
| Molecular Weight | 459.53 g/mol |
| Exact Mass | 459.21 |
| IUPAC Name | 4-(4-fluorophenyl)-N,N-dimethyl-3-[2-(4-morpholin-4-ylanilino)-4-pyridinyl]-1,2-oxazol-5-amine |
| SMILES | CN(C)c1onc(-c2ccnc(Nc3ccc(N4CCOCC4)cc3)c2)c1-c1ccc(F)cc1 |
| InChI | InChI=1S/C26H26FN5O2/c1-31(2)26-24(18-3-5-20(27)6-4-18)25(30-34-26)19-11-12-28-23(17-19)29-21-7-9-22(10-8-21)32-13-15-33-16-14-32/h3-12,17H,13-16H2,1-2H3,(H,28,29) |
| InChIKey | SAHIOUDYBIEVOE-UHFFFAOYSA-N |
| XLogP | 5.19 |
| TPSA | 66.66 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.53 |
| LogP ≤ 5 | 5.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|