C31H28FN5O2 — CID 72946454
N-benzyl-4-(4-fluorophenyl)-3-[2-(4-morpholin-4-ylanilino)-4-pyridinyl]-1,2-oxazol-5-amine (PubChem CID 72946454) has the molecular formula C31H28FN5O2 and a molecular weight of 521.60 g/mol. Its IUPAC name is N-benzyl-4-(4-fluorophenyl)-3-[2-(4-morpholin-4-ylanilino)-4-pyridinyl]-1,2-oxazol-5-amine.
| Compound Name | N-benzyl-4-(4-fluorophenyl)-3-[2-(4-morpholin-4-ylanilino)-4-pyridinyl]-1,2-oxazol-5-amine |
|---|---|
| PubChem CID | 72946454 |
| Molecular Formula | C31H28FN5O2 |
| Molecular Weight | 521.60 g/mol |
| Exact Mass | 521.22 |
| IUPAC Name | N-benzyl-4-(4-fluorophenyl)-3-[2-(4-morpholin-4-ylanilino)-4-pyridinyl]-1,2-oxazol-5-amine |
| SMILES | Fc1ccc(-c2c(-c3ccnc(Nc4ccc(N5CCOCC5)cc4)c3)noc2NCc2ccccc2)cc1 |
| InChI | InChI=1S/C31H28FN5O2/c32-25-8-6-23(7-9-25)29-30(36-39-31(29)34-21-22-4-2-1-3-5-22)24-14-15-33-28(20-24)35-26-10-12-27(13-11-26)37-16-18-38-19-17-37/h1-15,20,34H,16-19,21H2,(H,33,35) |
| InChIKey | KWDPUYBWFHVCIY-UHFFFAOYSA-N |
| XLogP | 6.74 |
| TPSA | 75.45 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 521.60 |
| LogP ≤ 5 | 6.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|