About [(3S,4S)-4-[(6-methyl-1H-benzimidazol-2-yl)amino]pyrrolidin-3-yl] 4-phenylbenzoate
[(3S,4S)-4-[(6-methyl-1H-benzimidazol-2-yl)amino]pyrrolidin-3-yl] 4-phenylbenzoate (PubChem CID 72946535) has the molecular formula C25H24N4O2
and a molecular weight of 412.49 g/mol. Its IUPAC name is [(3S,4S)-4-[(6-methyl-1H-benzimidazol-2-yl)amino]pyrrolidin-3-yl] 4-phenylbenzoate.
Molecular Properties
| Compound Name | [(3S,4S)-4-[(6-methyl-1H-benzimidazol-2-yl)amino]pyrrolidin-3-yl] 4-phenylbenzoate |
| PubChem CID | 72946535 |
| Molecular Formula | C25H24N4O2 |
| Molecular Weight | 412.49 g/mol |
| Exact Mass | 412.19 |
| IUPAC Name | [(3S,4S)-4-[(6-methyl-1H-benzimidazol-2-yl)amino]pyrrolidin-3-yl] 4-phenylbenzoate |
| SMILES | Cc1ccc2nc(N[C@H]3CNC[C@@H]3OC(=O)c3ccc(-c4ccccc4)cc3)[nH]c2c1 |
| InChI | InChI=1S/C25H24N4O2/c1-16-7-12-20-21(13-16)28-25(27-20)29-22-14-26-15-23(22)31-24(30)19-10-8-18(9-11-19)17-5-3-2-4-6-17/h2-13,22-23,26H,14-15H2,1H3,(H2,27,28,29)/t22-,23-/m0/s1 |
| InChIKey | GHIKRRXJYNSNNF-GOTSBHOMSA-N |
| XLogP | 4.15 |
| TPSA | 79.04 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 412.49 |
| LogP ≤ 5 | 4.15 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze [(3S,4S)-4-[(6-methyl-1H-benzimidazol-2-yl)amino]pyrrolidin-3-yl] 4-phenylbenzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(3S,4S)-4-[(6-methyl-1H-benzimidazol-2-yl)amino]pyrrolidin-3-yl] 4-phenylbenzoate?
The IUPAC name of [(3S,4S)-4-[(6-methyl-1H-benzimidazol-2-yl)amino]pyrrolidin-3-yl] 4-phenylbenzoate (CID 72946535) is [(3S,4S)-4-[(6-methyl-1H-benzimidazol-2-yl)amino]pyrrolidin-3-yl] 4-phenylbenzoate.
What is the SMILES notation for [(3S,4S)-4-[(6-methyl-1H-benzimidazol-2-yl)amino]pyrrolidin-3-yl] 4-phenylbenzoate?
The canonical SMILES for [(3S,4S)-4-[(6-methyl-1H-benzimidazol-2-yl)amino]pyrrolidin-3-yl] 4-phenylbenzoate is Cc1ccc2nc(N[C@H]3CNC[C@@H]3OC(=O)c3ccc(-c4ccccc4)cc3)[nH]c2c1.
What is the InChIKey of [(3S,4S)-4-[(6-methyl-1H-benzimidazol-2-yl)amino]pyrrolidin-3-yl] 4-phenylbenzoate?
The InChIKey is GHIKRRXJYNSNNF-GOTSBHOMSA-N. The full InChI is InChI=1S/C25H24N4O2/c1-16-7-12-20-21(13-16)28-25(27-20)29-22-14-26-15-23(22)31-24(30)19-10-8-18(9-11-19)17-5-3-2-4-6-17/h2-13,22-23,26H,14-15H2,1H3,(H2,27,28,29)/t22-,23-/m0/s1.
What are the key properties of [(3S,4S)-4-[(6-methyl-1H-benzimidazol-2-yl)amino]pyrrolidin-3-yl] 4-phenylbenzoate?
[(3S,4S)-4-[(6-methyl-1H-benzimidazol-2-yl)amino]pyrrolidin-3-yl] 4-phenylbenzoate has a molecular weight of 412.49 g/mol, XLogP of 4.15, 5 rotatable bonds, 3 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for [(3S,4S)-4-[(6-methyl-1H-benzimidazol-2-yl)amino]pyrrolidin-3-yl] 4-phenylbenzoate is sourced from PubChem (CID 72946535), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).