C22H16ClF2N5O4 — CID 72946560
13-(5-chloro-2-pyridinyl)-11-(2,6-difluoro-3,5-dimethoxyphenyl)-5,7,11,13-tetrazatricyclo[7.4.0.02,6]trideca-1,6,8-triene-4,12-dione (PubChem CID 72946560) has the molecular formula C22H16ClF2N5O4 and a molecular weight of 487.85 g/mol. Its IUPAC name is 13-(5-chloro-2-pyridinyl)-11-(2,6-difluoro-3,5-dimethoxyphenyl)-5,7,11,13-tetrazatricyclo[7.4.0.02,6]trideca-1,6,8-triene-4,12-dione.
| Compound Name | 13-(5-chloro-2-pyridinyl)-11-(2,6-difluoro-3,5-dimethoxyphenyl)-5,7,11,13-tetrazatricyclo[7.4.0.02,6]trideca-1,6,8-triene-4,12-dione |
|---|---|
| PubChem CID | 72946560 |
| Molecular Formula | C22H16ClF2N5O4 |
| Molecular Weight | 487.85 g/mol |
| Exact Mass | 487.09 |
| IUPAC Name | 13-(5-chloro-2-pyridinyl)-11-(2,6-difluoro-3,5-dimethoxyphenyl)-5,7,11,13-tetrazatricyclo[7.4.0.02,6]trideca-1,6,8-triene-4,12-dione |
| SMILES | COc1cc(OC)c(F)c(N2Cc3cnc4c(c3N(c3ccc(Cl)cn3)C2=O)CC(=O)N4)c1F |
| InChI | InChI=1S/C22H16ClF2N5O4/c1-33-13-6-14(34-2)18(25)20(17(13)24)29-9-10-7-27-21-12(5-16(31)28-21)19(10)30(22(29)32)15-4-3-11(23)8-26-15/h3-4,6-8H,5,9H2,1-2H3,(H,27,28,31) |
| InChIKey | CSQFYFINGHEYGG-UHFFFAOYSA-N |
| XLogP | 4.20 |
| TPSA | 96.89 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 487.85 |
| LogP ≤ 5 | 4.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |