C26H30FNO2 — CID 72946746
3-[[(8S,9S,13S,14S)-17-(5-fluoro-3-pyridinyl)-13-methyl-6,7,8,9,11,12,14,15-octahydrocyclopenta[a]phenanthren-3-yl]oxy]propan-1-ol (PubChem CID 72946746) has the molecular formula C26H30FNO2 and a molecular weight of 407.53 g/mol. Its IUPAC name is 3-[[(8S,9S,13S,14S)-17-(5-fluoro-3-pyridinyl)-13-methyl-6,7,8,9,11,12,14,15-octahydrocyclopenta[a]phenanthren-3-yl]oxy]propan-1-ol.
| Compound Name | 3-[[(8S,9S,13S,14S)-17-(5-fluoro-3-pyridinyl)-13-methyl-6,7,8,9,11,12,14,15-octahydrocyclopenta[a]phenanthren-3-yl]oxy]propan-1-ol |
|---|---|
| PubChem CID | 72946746 |
| Molecular Formula | C26H30FNO2 |
| Molecular Weight | 407.53 g/mol |
| Exact Mass | 407.23 |
| IUPAC Name | 3-[[(8S,9S,13S,14S)-17-(5-fluoro-3-pyridinyl)-13-methyl-6,7,8,9,11,12,14,15-octahydrocyclopenta[a]phenanthren-3-yl]oxy]propan-1-ol |
| SMILES | C[C@]12CC[C@@H]3c4ccc(OCCCO)cc4CC[C@H]3[C@@H]1CC=C2c1cncc(F)c1 |
| InChI | InChI=1S/C26H30FNO2/c1-26-10-9-22-21-6-4-20(30-12-2-11-29)14-17(21)3-5-23(22)25(26)8-7-24(26)18-13-19(27)16-28-15-18/h4,6-7,13-16,22-23,25,29H,2-3,5,8-12H2,1H3/t22-,23-,25+,26-/m1/s1 |
| InChIKey | YYGMHOOOXJIUGG-VHCQPULKSA-N |
| XLogP | 5.53 |
| TPSA | 42.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.53 |
| LogP ≤ 5 | 5.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|