C25H30N4O5 — CID 72946836
(2S)-N'-hydroxy-2-[(2-oxo-4-phenylpyrrolidine-3-carbonyl)amino]-N-phenyloctanediamide (PubChem CID 72946836) has the molecular formula C25H30N4O5 and a molecular weight of 466.54 g/mol. Its IUPAC name is (2S)-N'-hydroxy-2-[(2-oxo-4-phenylpyrrolidine-3-carbonyl)amino]-N-phenyloctanediamide.
| Compound Name | (2S)-N'-hydroxy-2-[(2-oxo-4-phenylpyrrolidine-3-carbonyl)amino]-N-phenyloctanediamide |
|---|---|
| PubChem CID | 72946836 |
| Molecular Formula | C25H30N4O5 |
| Molecular Weight | 466.54 g/mol |
| Exact Mass | 466.22 |
| IUPAC Name | (2S)-N'-hydroxy-2-[(2-oxo-4-phenylpyrrolidine-3-carbonyl)amino]-N-phenyloctanediamide |
| SMILES | O=C(CCCCC[C@H](NC(=O)C1C(=O)NCC1c1ccccc1)C(=O)Nc1ccccc1)NO |
| InChI | InChI=1S/C25H30N4O5/c30-21(29-34)15-9-3-8-14-20(23(31)27-18-12-6-2-7-13-18)28-25(33)22-19(16-26-24(22)32)17-10-4-1-5-11-17/h1-2,4-7,10-13,19-20,22,34H,3,8-9,14-16H2,(H,26,32)(H,27,31)(H,28,33)(H,29,30)/t19?,20-,22?/m0/s1 |
| InChIKey | OICURQWOFDGPNS-FUHYEJFZSA-N |
| XLogP | 2.10 |
| TPSA | 136.63 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.54 |
| LogP ≤ 5 | 2.10 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|