C28H34FNO2 — CID 72946947
3-[[(8S,9S,13S,14S)-17-(5-fluoro-3-pyridinyl)-13-methyl-6,7,8,9,11,12,14,15-octahydrocyclopenta[a]phenanthren-3-yl]oxy]-2,2-dimethylpropan-1-ol (PubChem CID 72946947) has the molecular formula C28H34FNO2 and a molecular weight of 435.58 g/mol. Its IUPAC name is 3-[[(8S,9S,13S,14S)-17-(5-fluoro-3-pyridinyl)-13-methyl-6,7,8,9,11,12,14,15-octahydrocyclopenta[a]phenanthren-3-yl]oxy]-2,2-dimethylpropan-1-ol.
| Compound Name | 3-[[(8S,9S,13S,14S)-17-(5-fluoro-3-pyridinyl)-13-methyl-6,7,8,9,11,12,14,15-octahydrocyclopenta[a]phenanthren-3-yl]oxy]-2,2-dimethylpropan-1-ol |
|---|---|
| PubChem CID | 72946947 |
| Molecular Formula | C28H34FNO2 |
| Molecular Weight | 435.58 g/mol |
| Exact Mass | 435.26 |
| IUPAC Name | 3-[[(8S,9S,13S,14S)-17-(5-fluoro-3-pyridinyl)-13-methyl-6,7,8,9,11,12,14,15-octahydrocyclopenta[a]phenanthren-3-yl]oxy]-2,2-dimethylpropan-1-ol |
| SMILES | CC(C)(CO)COc1ccc2c(c1)CC[C@@H]1[C@@H]2CC[C@]2(C)C(c3cncc(F)c3)=CC[C@@H]12 |
| InChI | InChI=1S/C28H34FNO2/c1-27(2,16-31)17-32-21-5-7-22-18(13-21)4-6-24-23(22)10-11-28(3)25(8-9-26(24)28)19-12-20(29)15-30-14-19/h5,7-8,12-15,23-24,26,31H,4,6,9-11,16-17H2,1-3H3/t23-,24-,26+,28-/m1/s1 |
| InChIKey | FPAVQUJKZMWCPR-WXGXSRQYSA-N |
| XLogP | 6.17 |
| TPSA | 42.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.58 |
| LogP ≤ 5 | 6.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |