C22H22F2N4O4 — CID 72947180
11-(2,6-difluoro-3,5-dimethoxyphenyl)-13-[(1R,2R)-2-hydroxycyclopentyl]-5,7,11,13-tetrazatricyclo[7.4.0.02,6]trideca-1,3,6,8-tetraen-12-one (PubChem CID 72947180) has the molecular formula C22H22F2N4O4 and a molecular weight of 444.44 g/mol. Its IUPAC name is 11-(2,6-difluoro-3,5-dimethoxyphenyl)-13-[(1R,2R)-2-hydroxycyclopentyl]-5,7,11,13-tetrazatricyclo[7.4.0.02,6]trideca-1,3,6,8-tetraen-12-one.
| Compound Name | 11-(2,6-difluoro-3,5-dimethoxyphenyl)-13-[(1R,2R)-2-hydroxycyclopentyl]-5,7,11,13-tetrazatricyclo[7.4.0.02,6]trideca-1,3,6,8-tetraen-12-one |
|---|---|
| PubChem CID | 72947180 |
| Molecular Formula | C22H22F2N4O4 |
| Molecular Weight | 444.44 g/mol |
| Exact Mass | 444.16 |
| IUPAC Name | 11-(2,6-difluoro-3,5-dimethoxyphenyl)-13-[(1R,2R)-2-hydroxycyclopentyl]-5,7,11,13-tetrazatricyclo[7.4.0.02,6]trideca-1,3,6,8-tetraen-12-one |
| SMILES | COc1cc(OC)c(F)c(N2Cc3cnc4[nH]ccc4c3N([C@@H]3CCC[C@H]3O)C2=O)c1F |
| InChI | InChI=1S/C22H22F2N4O4/c1-31-15-8-16(32-2)18(24)20(17(15)23)27-10-11-9-26-21-12(6-7-25-21)19(11)28(22(27)30)13-4-3-5-14(13)29/h6-9,13-14,29H,3-5,10H2,1-2H3,(H,25,26)/t13-,14-/m1/s1 |
| InChIKey | ILNCSRUGKNZIBY-ZIAGYGMSSA-N |
| XLogP | 3.72 |
| TPSA | 90.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.44 |
| LogP ≤ 5 | 3.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |