C26H31F2N5O3 — CID 72947181
11-(2,6-difluoro-3,5-dimethoxyphenyl)-4-[(1-ethylpiperidin-4-yl)methyl]-13-methyl-5,7,11,13-tetrazatricyclo[7.4.0.02,6]trideca-1,3,6,8-tetraen-12-one (PubChem CID 72947181) has the molecular formula C26H31F2N5O3 and a molecular weight of 499.56 g/mol. Its IUPAC name is 11-(2,6-difluoro-3,5-dimethoxyphenyl)-4-[(1-ethylpiperidin-4-yl)methyl]-13-methyl-5,7,11,13-tetrazatricyclo[7.4.0.02,6]trideca-1,3,6,8-tetraen-12-one.
| Compound Name | 11-(2,6-difluoro-3,5-dimethoxyphenyl)-4-[(1-ethylpiperidin-4-yl)methyl]-13-methyl-5,7,11,13-tetrazatricyclo[7.4.0.02,6]trideca-1,3,6,8-tetraen-12-one |
|---|---|
| PubChem CID | 72947181 |
| Molecular Formula | C26H31F2N5O3 |
| Molecular Weight | 499.56 g/mol |
| Exact Mass | 499.24 |
| IUPAC Name | 11-(2,6-difluoro-3,5-dimethoxyphenyl)-4-[(1-ethylpiperidin-4-yl)methyl]-13-methyl-5,7,11,13-tetrazatricyclo[7.4.0.02,6]trideca-1,3,6,8-tetraen-12-one |
| SMILES | CCN1CCC(Cc2cc3c4c(cnc3[nH]2)CN(c2c(F)c(OC)cc(OC)c2F)C(=O)N4C)CC1 |
| InChI | InChI=1S/C26H31F2N5O3/c1-5-32-8-6-15(7-9-32)10-17-11-18-23-16(13-29-25(18)30-17)14-33(26(34)31(23)2)24-21(27)19(35-3)12-20(36-4)22(24)28/h11-13,15H,5-10,14H2,1-4H3,(H,29,30) |
| InChIKey | BGKBXKRRVUCFLS-UHFFFAOYSA-N |
| XLogP | 4.71 |
| TPSA | 73.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 499.56 |
| LogP ≤ 5 | 4.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |