C14H16O6 — CID 72947237
3-[(2R,4R)-2,4-dihydroxypentyl]-6,8-dihydroxyisochromen-1-one (PubChem CID 72947237) has the molecular formula C14H16O6 and a molecular weight of 280.28 g/mol. Its IUPAC name is 3-[(2R,4R)-2,4-dihydroxypentyl]-6,8-dihydroxyisochromen-1-one.
| Compound Name | 3-[(2R,4R)-2,4-dihydroxypentyl]-6,8-dihydroxyisochromen-1-one |
|---|---|
| PubChem CID | 72947237 |
| Molecular Formula | C14H16O6 |
| Molecular Weight | 280.28 g/mol |
| Exact Mass | 280.09 |
| IUPAC Name | 3-[(2R,4R)-2,4-dihydroxypentyl]-6,8-dihydroxyisochromen-1-one |
| SMILES | C[C@@H](O)C[C@@H](O)Cc1cc2cc(O)cc(O)c2c(=O)o1 |
| InChI | InChI=1S/C14H16O6/c1-7(15)2-9(16)5-11-4-8-3-10(17)6-12(18)13(8)14(19)20-11/h3-4,6-7,9,15-18H,2,5H2,1H3/t7-,9-/m1/s1 |
| InChIKey | CQXZVXNVRFIVCN-VXNVDRBHSA-N |
| XLogP | 0.88 |
| TPSA | 111.13 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.28 |
| LogP ≤ 5 | 0.88 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |