About 7-methoxyspiro[2,3-dihydrochromene-4,3'-2H-isoindole]-1'-one
7-methoxyspiro[2,3-dihydrochromene-4,3'-2H-isoindole]-1'-one (PubChem CID 72947320) has the molecular formula C17H15NO3
and a molecular weight of 281.31 g/mol. Its IUPAC name is 7-methoxyspiro[2,3-dihydrochromene-4,3'-2H-isoindole]-1'-one.
Molecular Properties
| Compound Name | 7-methoxyspiro[2,3-dihydrochromene-4,3'-2H-isoindole]-1'-one |
| PubChem CID | 72947320 |
| Molecular Formula | C17H15NO3 |
| Molecular Weight | 281.31 g/mol |
| Exact Mass | 281.11 |
| IUPAC Name | 7-methoxyspiro[2,3-dihydrochromene-4,3'-2H-isoindole]-1'-one |
| SMILES | COc1ccc2c(c1)OCCC21NC(=O)c2ccccc21 |
| InChI | InChI=1S/C17H15NO3/c1-20-11-6-7-14-15(10-11)21-9-8-17(14)13-5-3-2-4-12(13)16(19)18-17/h2-7,10H,8-9H2,1H3,(H,18,19) |
| InChIKey | ZCUKIAOYJHPXHM-UHFFFAOYSA-N |
| XLogP | 2.46 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 281.31 |
| LogP ≤ 5 | 2.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 7-methoxyspiro[2,3-dihydrochromene-4,3'-2H-isoindole]-1'-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 7-methoxyspiro[2,3-dihydrochromene-4,3'-2H-isoindole]-1'-one?
The IUPAC name of 7-methoxyspiro[2,3-dihydrochromene-4,3'-2H-isoindole]-1'-one (CID 72947320) is 7-methoxyspiro[2,3-dihydrochromene-4,3'-2H-isoindole]-1'-one.
What is the SMILES notation for 7-methoxyspiro[2,3-dihydrochromene-4,3'-2H-isoindole]-1'-one?
The canonical SMILES for 7-methoxyspiro[2,3-dihydrochromene-4,3'-2H-isoindole]-1'-one is COc1ccc2c(c1)OCCC21NC(=O)c2ccccc21.
What is the InChIKey of 7-methoxyspiro[2,3-dihydrochromene-4,3'-2H-isoindole]-1'-one?
The InChIKey is ZCUKIAOYJHPXHM-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H15NO3/c1-20-11-6-7-14-15(10-11)21-9-8-17(14)13-5-3-2-4-12(13)16(19)18-17/h2-7,10H,8-9H2,1H3,(H,18,19).
What are the key properties of 7-methoxyspiro[2,3-dihydrochromene-4,3'-2H-isoindole]-1'-one?
7-methoxyspiro[2,3-dihydrochromene-4,3'-2H-isoindole]-1'-one has a molecular weight of 281.31 g/mol, XLogP of 2.46, 1 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 7-methoxyspiro[2,3-dihydrochromene-4,3'-2H-isoindole]-1'-one is sourced from PubChem (CID 72947320), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).