C23H19F2N5O4 — CID 72947404
11-(2,6-difluoro-3,5-dimethoxyphenyl)-13-(pyridin-2-ylmethyl)-5,7,11,13-tetrazatricyclo[7.4.0.02,6]trideca-1,6,8-triene-4,12-dione (PubChem CID 72947404) has the molecular formula C23H19F2N5O4 and a molecular weight of 467.43 g/mol. Its IUPAC name is 11-(2,6-difluoro-3,5-dimethoxyphenyl)-13-(pyridin-2-ylmethyl)-5,7,11,13-tetrazatricyclo[7.4.0.02,6]trideca-1,6,8-triene-4,12-dione.
| Compound Name | 11-(2,6-difluoro-3,5-dimethoxyphenyl)-13-(pyridin-2-ylmethyl)-5,7,11,13-tetrazatricyclo[7.4.0.02,6]trideca-1,6,8-triene-4,12-dione |
|---|---|
| PubChem CID | 72947404 |
| Molecular Formula | C23H19F2N5O4 |
| Molecular Weight | 467.43 g/mol |
| Exact Mass | 467.14 |
| IUPAC Name | 11-(2,6-difluoro-3,5-dimethoxyphenyl)-13-(pyridin-2-ylmethyl)-5,7,11,13-tetrazatricyclo[7.4.0.02,6]trideca-1,6,8-triene-4,12-dione |
| SMILES | COc1cc(OC)c(F)c(N2Cc3cnc4c(c3N(Cc3ccccn3)C2=O)CC(=O)N4)c1F |
| InChI | InChI=1S/C23H19F2N5O4/c1-33-15-8-16(34-2)19(25)21(18(15)24)29-10-12-9-27-22-14(7-17(31)28-22)20(12)30(23(29)32)11-13-5-3-4-6-26-13/h3-6,8-9H,7,10-11H2,1-2H3,(H,27,28,31) |
| InChIKey | PCLUIIRLSVLANK-UHFFFAOYSA-N |
| XLogP | 3.41 |
| TPSA | 96.89 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 467.43 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |