C14H19N2O4P — CID 72947436
4-diethoxyphosphoryl-5-methyl-2-phenyl-1H-pyrazol-3-one (PubChem CID 72947436) has the molecular formula C14H19N2O4P and a molecular weight of 310.29 g/mol. Its IUPAC name is 4-diethoxyphosphoryl-5-methyl-2-phenyl-1H-pyrazol-3-one.
| Compound Name | 4-diethoxyphosphoryl-5-methyl-2-phenyl-1H-pyrazol-3-one |
|---|---|
| PubChem CID | 72947436 |
| Molecular Formula | C14H19N2O4P |
| Molecular Weight | 310.29 g/mol |
| Exact Mass | 310.11 |
| IUPAC Name | 4-diethoxyphosphoryl-5-methyl-2-phenyl-1H-pyrazol-3-one |
| SMILES | CCOP(=O)(OCC)c1c(C)[nH]n(-c2ccccc2)c1=O |
| InChI | InChI=1S/C14H19N2O4P/c1-4-19-21(18,20-5-2)13-11(3)15-16(14(13)17)12-9-7-6-8-10-12/h6-10,15H,4-5H2,1-3H3 |
| InChIKey | YFWZVIGAVRJRPQ-UHFFFAOYSA-N |
| XLogP | 2.37 |
| TPSA | 73.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.29 |
| LogP ≤ 5 | 2.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|