About (2,6-dimethoxyphenyl)-(4,5-dimethyl-1,3-thiazol-2-yl)methanone
(2,6-dimethoxyphenyl)-(4,5-dimethyl-1,3-thiazol-2-yl)methanone (PubChem CID 72947439) has the molecular formula C14H15NO3S
and a molecular weight of 277.35 g/mol. Its IUPAC name is (2,6-dimethoxyphenyl)-(4,5-dimethyl-1,3-thiazol-2-yl)methanone.
Molecular Properties
| Compound Name | (2,6-dimethoxyphenyl)-(4,5-dimethyl-1,3-thiazol-2-yl)methanone |
| PubChem CID | 72947439 |
| Molecular Formula | C14H15NO3S |
| Molecular Weight | 277.35 g/mol |
| Exact Mass | 277.08 |
| IUPAC Name | (2,6-dimethoxyphenyl)-(4,5-dimethyl-1,3-thiazol-2-yl)methanone |
| SMILES | COc1cccc(OC)c1C(=O)c1nc(C)c(C)s1 |
| InChI | InChI=1S/C14H15NO3S/c1-8-9(2)19-14(15-8)13(16)12-10(17-3)6-5-7-11(12)18-4/h5-7H,1-4H3 |
| InChIKey | PRQVBTJUOMXZNG-UHFFFAOYSA-N |
| XLogP | 3.01 |
| TPSA | 48.42 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 277.35 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze (2,6-dimethoxyphenyl)-(4,5-dimethyl-1,3-thiazol-2-yl)methanone with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2,6-dimethoxyphenyl)-(4,5-dimethyl-1,3-thiazol-2-yl)methanone?
The IUPAC name of (2,6-dimethoxyphenyl)-(4,5-dimethyl-1,3-thiazol-2-yl)methanone (CID 72947439) is (2,6-dimethoxyphenyl)-(4,5-dimethyl-1,3-thiazol-2-yl)methanone.
What is the SMILES notation for (2,6-dimethoxyphenyl)-(4,5-dimethyl-1,3-thiazol-2-yl)methanone?
The canonical SMILES for (2,6-dimethoxyphenyl)-(4,5-dimethyl-1,3-thiazol-2-yl)methanone is COc1cccc(OC)c1C(=O)c1nc(C)c(C)s1.
What is the InChIKey of (2,6-dimethoxyphenyl)-(4,5-dimethyl-1,3-thiazol-2-yl)methanone?
The InChIKey is PRQVBTJUOMXZNG-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H15NO3S/c1-8-9(2)19-14(15-8)13(16)12-10(17-3)6-5-7-11(12)18-4/h5-7H,1-4H3.
What are the key properties of (2,6-dimethoxyphenyl)-(4,5-dimethyl-1,3-thiazol-2-yl)methanone?
(2,6-dimethoxyphenyl)-(4,5-dimethyl-1,3-thiazol-2-yl)methanone has a molecular weight of 277.35 g/mol, XLogP of 3.01, 4 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for (2,6-dimethoxyphenyl)-(4,5-dimethyl-1,3-thiazol-2-yl)methanone is sourced from PubChem (CID 72947439), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).