About CID 72947645
CID 72947645 (PubChem CID 72947645) has the molecular formula C28H37BFeO6+2
and a molecular weight of 536.26 g/mol.
Molecular Properties
| Compound Name | CID 72947645 |
| PubChem CID | 72947645 |
| Molecular Formula | C28H37BFeO6+2 |
| Molecular Weight | 536.26 g/mol |
| Exact Mass | 536.20 |
| IUPAC Name | — |
| SMILES | [CH]1[CH][CH][CH][CH]1.[CH]1[CH][CH][C](B2O[C@@H](C3COC4(CCCCC4)O3)[C@H](C3COC4(CCCCC4)O3)O2)[CH]1.[Fe+2] |
| InChI | InChI=1S/C23H32BO6.C5H5.Fe/c1-5-11-22(12-6-1)25-15-18(27-22)20-21(30-24(29-20)17-9-3-4-10-17)19-16-26-23(28-19)13-7-2-8-14-23;1-2-4-5-3-1;/h3-4,9-10,18-21H,1-2,5-8,11-16H2;1-5H;/q;;+2/t18?,19?,20-,21-;;/m0../s1 |
| InChIKey | HFXPAWONBOGLTB-WHNUISMOSA-N |
| XLogP | 4.37 |
| TPSA | 55.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 36 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 536.26 |
| LogP ≤ 5 | 4.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze CID 72947645 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 72947645?
The IUPAC name of CID 72947645 (CID 72947645) is not available.
What is the SMILES notation for CID 72947645?
The canonical SMILES for CID 72947645 is [CH]1[CH][CH][CH][CH]1.[CH]1[CH][CH][C](B2O[C@@H](C3COC4(CCCCC4)O3)[C@H](C3COC4(CCCCC4)O3)O2)[CH]1.[Fe+2].
What is the InChIKey of CID 72947645?
The InChIKey is HFXPAWONBOGLTB-WHNUISMOSA-N. The full InChI is InChI=1S/C23H32BO6.C5H5.Fe/c1-5-11-22(12-6-1)25-15-18(27-22)20-21(30-24(29-20)17-9-3-4-10-17)19-16-26-23(28-19)13-7-2-8-14-23;1-2-4-5-3-1;/h3-4,9-10,18-21H,1-2,5-8,11-16H2;1-5H;/q;;+2/t18?,19?,20-,21-;;/m0../s1.
What are the key properties of CID 72947645?
CID 72947645 has a molecular weight of 536.26 g/mol, XLogP of 4.37, 3 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for CID 72947645 is sourced from PubChem (CID 72947645), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).