C10H12N8 — CID 729477
3,5-bis(imidazol-1-ylmethyl)-1,2,4-triazol-4-amine (PubChem CID 729477) has the molecular formula C10H12N8 and a molecular weight of 244.26 g/mol. Its IUPAC name is 3,5-bis(imidazol-1-ylmethyl)-1,2,4-triazol-4-amine.
| Compound Name | 3,5-bis(imidazol-1-ylmethyl)-1,2,4-triazol-4-amine |
|---|---|
| PubChem CID | 729477 |
| Molecular Formula | C10H12N8 |
| Molecular Weight | 244.26 g/mol |
| Exact Mass | 244.12 |
| IUPAC Name | 3,5-bis(imidazol-1-ylmethyl)-1,2,4-triazol-4-amine |
| SMILES | Nn1c(Cn2ccnc2)nnc1Cn1ccnc1 |
| InChI | InChI=1S/C10H12N8/c11-18-9(5-16-3-1-12-7-16)14-15-10(18)6-17-4-2-13-8-17/h1-4,7-8H,5-6,11H2 |
| InChIKey | MHLOVJAHALILDE-UHFFFAOYSA-N |
| XLogP | -0.52 |
| TPSA | 92.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 244.26 |
| LogP ≤ 5 | -0.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |