C21H23N4O3S+ — CID 7294781
3-[1,3-benzothiazol-2-yl-[(Z)-3-(4-nitrophenyl)prop-2-enoyl]amino]propyl-dimethylazanium (PubChem CID 7294781) has the molecular formula C21H23N4O3S+ and a molecular weight of 411.51 g/mol. Its IUPAC name is 3-[1,3-benzothiazol-2-yl-[(Z)-3-(4-nitrophenyl)prop-2-enoyl]amino]propyl-dimethylazanium.
| Compound Name | 3-[1,3-benzothiazol-2-yl-[(Z)-3-(4-nitrophenyl)prop-2-enoyl]amino]propyl-dimethylazanium |
|---|---|
| PubChem CID | 7294781 |
| Molecular Formula | C21H23N4O3S+ |
| Molecular Weight | 411.51 g/mol |
| Exact Mass | 411.15 |
| IUPAC Name | 3-[1,3-benzothiazol-2-yl-[(Z)-3-(4-nitrophenyl)prop-2-enoyl]amino]propyl-dimethylazanium |
| SMILES | C[NH+](C)CCCN(C(=O)/C=C\c1ccc([N+](=O)[O-])cc1)c1nc2ccccc2s1 |
| InChI | InChI=1S/C21H22N4O3S/c1-23(2)14-5-15-24(21-22-18-6-3-4-7-19(18)29-21)20(26)13-10-16-8-11-17(12-9-16)25(27)28/h3-4,6-13H,5,14-15H2,1-2H3/p+1/b13-10- |
| InChIKey | YZCOUOZFSUJXCI-RAXLEYEMSA-O |
| XLogP | 2.79 |
| TPSA | 80.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.51 |
| LogP ≤ 5 | 2.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|