C11H13ClN2O4 — CID 72947841
(1R,2S,3R)-1-(6-chloro-1H-benzimidazol-2-yl)butane-1,2,3,4-tetrol (PubChem CID 72947841) has the molecular formula C11H13ClN2O4 and a molecular weight of 272.69 g/mol. Its IUPAC name is (1R,2S,3R)-1-(6-chloro-1H-benzimidazol-2-yl)butane-1,2,3,4-tetrol.
| Compound Name | (1R,2S,3R)-1-(6-chloro-1H-benzimidazol-2-yl)butane-1,2,3,4-tetrol |
|---|---|
| PubChem CID | 72947841 |
| Molecular Formula | C11H13ClN2O4 |
| Molecular Weight | 272.69 g/mol |
| Exact Mass | 272.06 |
| IUPAC Name | (1R,2S,3R)-1-(6-chloro-1H-benzimidazol-2-yl)butane-1,2,3,4-tetrol |
| SMILES | OC[C@@H](O)[C@@H](O)[C@H](O)c1nc2ccc(Cl)cc2[nH]1 |
| InChI | InChI=1S/C11H13ClN2O4/c12-5-1-2-6-7(3-5)14-11(13-6)10(18)9(17)8(16)4-15/h1-3,8-10,15-18H,4H2,(H,13,14)/t8-,9-,10+/m1/s1 |
| InChIKey | BKHRWVDCLSMCCN-BBBLOLIVSA-N |
| XLogP | -0.04 |
| TPSA | 109.60 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.69 |
| LogP ≤ 5 | -0.04 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 5 |