About Violapyrone G
Violapyrone G (PubChem CID 72947856) has the molecular formula C14H22O4
and a molecular weight of 254.32 g/mol. Its IUPAC name is 6-(5-hydroxy-5-methylhexyl)-4-methoxy-3-methylpyran-2-one.
Molecular Properties
| Compound Name | Violapyrone G |
| PubChem CID | 72947856 |
| Molecular Formula | C14H22O4 |
| Molecular Weight | 254.32 g/mol |
| Exact Mass | 254.15 |
| IUPAC Name | 6-(5-hydroxy-5-methylhexyl)-4-methoxy-3-methylpyran-2-one |
| SMILES | CC1=C(C=C(OC1=O)CCCCC(C)(C)O)OC |
| InChI | InChI=1S/C14H22O4/c1-10-12(17-4)9-11(18-13(10)15)7-5-6-8-14(2,3)16/h9,16H,5-8H2,1-4H3 |
| InChIKey | IYROPNSRVNRQKE-UHFFFAOYSA-N |
| XLogP | 2.10 |
| TPSA | 55.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | 377 |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 254.32 |
| LogP ≤ 5 | 2.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze Violapyrone G with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of Violapyrone G?
The IUPAC name of Violapyrone G (CID 72947856) is 6-(5-hydroxy-5-methylhexyl)-4-methoxy-3-methylpyran-2-one.
What is the SMILES notation for Violapyrone G?
The canonical SMILES for Violapyrone G is CC1=C(C=C(OC1=O)CCCCC(C)(C)O)OC.
What is the InChIKey of Violapyrone G?
The InChIKey is IYROPNSRVNRQKE-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H22O4/c1-10-12(17-4)9-11(18-13(10)15)7-5-6-8-14(2,3)16/h9,16H,5-8H2,1-4H3.
What are the key properties of Violapyrone G?
Violapyrone G has a molecular weight of 254.32 g/mol, XLogP of 2.10, 6 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for Violapyrone G is sourced from PubChem (CID 72947856), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).