Violapyrone G

C14H22O4 — CID 72947856

IUPAC6-(5-hydroxy-5-methylhexyl)-4-methoxy-3-methylpyran-2-one
SMILESCC1=C(C=C(OC1=O)CCCCC(C)(C)O)OC
InChIInChI=1S/C14H22O4/c1-10-12(17-4)9-11(18-13(10)15)7-5-6-8-14(2,3)16/h9,16H,5-8H2,1-4H3
InChIKeyIYROPNSRVNRQKE-UHFFFAOYSA-N
MW254.32 g/mol
LogP2.10
Rot. Bonds6

About Violapyrone G

Violapyrone G (PubChem CID 72947856) has the molecular formula C14H22O4 and a molecular weight of 254.32 g/mol. Its IUPAC name is 6-(5-hydroxy-5-methylhexyl)-4-methoxy-3-methylpyran-2-one.

Molecular Properties

Compound NameViolapyrone G
PubChem CID72947856
Molecular FormulaC14H22O4
Molecular Weight254.32 g/mol
Exact Mass254.15
IUPAC Name6-(5-hydroxy-5-methylhexyl)-4-methoxy-3-methylpyran-2-one
SMILESCC1=C(C=C(OC1=O)CCCCC(C)(C)O)OC
InChIInChI=1S/C14H22O4/c1-10-12(17-4)9-11(18-13(10)15)7-5-6-8-14(2,3)16/h9,16H,5-8H2,1-4H3
InChIKeyIYROPNSRVNRQKE-UHFFFAOYSA-N
XLogP2.10
TPSA55.80 Ų
H-Bond Donors1
H-Bond Acceptors4
Rotatable Bonds6
Heavy Atoms18
Complexity377

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500254.32
LogP ≤ 52.10
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 104

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}

Analyze Violapyrone G with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of Violapyrone G?
The IUPAC name of Violapyrone G (CID 72947856) is 6-(5-hydroxy-5-methylhexyl)-4-methoxy-3-methylpyran-2-one.
What is the SMILES notation for Violapyrone G?
The canonical SMILES for Violapyrone G is CC1=C(C=C(OC1=O)CCCCC(C)(C)O)OC.
What is the InChIKey of Violapyrone G?
The InChIKey is IYROPNSRVNRQKE-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H22O4/c1-10-12(17-4)9-11(18-13(10)15)7-5-6-8-14(2,3)16/h9,16H,5-8H2,1-4H3.
What are the key properties of Violapyrone G?
Violapyrone G has a molecular weight of 254.32 g/mol, XLogP of 2.10, 6 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for Violapyrone G is sourced from PubChem (CID 72947856), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).