C24H23N5O — CID 72948288
4-[4-amino-5-(4-cyanoanilino)-2-(methylaminomethyl)phenoxy]-3,5-dimethylbenzonitrile (PubChem CID 72948288) has the molecular formula C24H23N5O and a molecular weight of 397.48 g/mol. Its IUPAC name is 4-[4-amino-5-(4-cyanoanilino)-2-(methylaminomethyl)phenoxy]-3,5-dimethylbenzonitrile.
| Compound Name | 4-[4-amino-5-(4-cyanoanilino)-2-(methylaminomethyl)phenoxy]-3,5-dimethylbenzonitrile |
|---|---|
| PubChem CID | 72948288 |
| Molecular Formula | C24H23N5O |
| Molecular Weight | 397.48 g/mol |
| Exact Mass | 397.19 |
| IUPAC Name | 4-[4-amino-5-(4-cyanoanilino)-2-(methylaminomethyl)phenoxy]-3,5-dimethylbenzonitrile |
| SMILES | CNCc1cc(N)c(Nc2ccc(C#N)cc2)cc1Oc1c(C)cc(C#N)cc1C |
| InChI | InChI=1S/C24H23N5O/c1-15-8-18(13-26)9-16(2)24(15)30-23-11-22(21(27)10-19(23)14-28-3)29-20-6-4-17(12-25)5-7-20/h4-11,28-29H,14,27H2,1-3H3 |
| InChIKey | DPNKNLPTCJIASG-UHFFFAOYSA-N |
| XLogP | 4.88 |
| TPSA | 106.89 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.48 |
| LogP ≤ 5 | 4.88 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|