About 2-(5-nitrofuran-2-yl)-1-(2-phenylpropyl)-5H-imidazo[4,5-g]quinoxalin-6-one
2-(5-nitrofuran-2-yl)-1-(2-phenylpropyl)-5H-imidazo[4,5-g]quinoxalin-6-one (PubChem CID 72948312) has the molecular formula C22H17N5O4
and a molecular weight of 415.41 g/mol. Its IUPAC name is 2-(5-nitrofuran-2-yl)-1-(2-phenylpropyl)-5H-imidazo[4,5-g]quinoxalin-6-one.
Molecular Properties
| Compound Name | 2-(5-nitrofuran-2-yl)-1-(2-phenylpropyl)-5H-imidazo[4,5-g]quinoxalin-6-one |
| PubChem CID | 72948312 |
| Molecular Formula | C22H17N5O4 |
| Molecular Weight | 415.41 g/mol |
| Exact Mass | 415.13 |
| IUPAC Name | 2-(5-nitrofuran-2-yl)-1-(2-phenylpropyl)-5H-imidazo[4,5-g]quinoxalin-6-one |
| SMILES | CC(Cn1c(-c2ccc([N+](=O)[O-])o2)nc2cc3[nH]c(=O)cnc3cc21)c1ccccc1 |
| InChI | InChI=1S/C22H17N5O4/c1-13(14-5-3-2-4-6-14)12-26-18-10-15-16(24-20(28)11-23-15)9-17(18)25-22(26)19-7-8-21(31-19)27(29)30/h2-11,13H,12H2,1H3,(H,24,28) |
| InChIKey | ZWTHTNALYGGOSS-UHFFFAOYSA-N |
| XLogP | 4.24 |
| TPSA | 119.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 415.41 |
| LogP ≤ 5 | 4.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 2-(5-nitrofuran-2-yl)-1-(2-phenylpropyl)-5H-imidazo[4,5-g]quinoxalin-6-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(5-nitrofuran-2-yl)-1-(2-phenylpropyl)-5H-imidazo[4,5-g]quinoxalin-6-one?
The IUPAC name of 2-(5-nitrofuran-2-yl)-1-(2-phenylpropyl)-5H-imidazo[4,5-g]quinoxalin-6-one (CID 72948312) is 2-(5-nitrofuran-2-yl)-1-(2-phenylpropyl)-5H-imidazo[4,5-g]quinoxalin-6-one.
What is the SMILES notation for 2-(5-nitrofuran-2-yl)-1-(2-phenylpropyl)-5H-imidazo[4,5-g]quinoxalin-6-one?
The canonical SMILES for 2-(5-nitrofuran-2-yl)-1-(2-phenylpropyl)-5H-imidazo[4,5-g]quinoxalin-6-one is CC(Cn1c(-c2ccc([N+](=O)[O-])o2)nc2cc3[nH]c(=O)cnc3cc21)c1ccccc1.
What is the InChIKey of 2-(5-nitrofuran-2-yl)-1-(2-phenylpropyl)-5H-imidazo[4,5-g]quinoxalin-6-one?
The InChIKey is ZWTHTNALYGGOSS-UHFFFAOYSA-N. The full InChI is InChI=1S/C22H17N5O4/c1-13(14-5-3-2-4-6-14)12-26-18-10-15-16(24-20(28)11-23-15)9-17(18)25-22(26)19-7-8-21(31-19)27(29)30/h2-11,13H,12H2,1H3,(H,24,28).
What are the key properties of 2-(5-nitrofuran-2-yl)-1-(2-phenylpropyl)-5H-imidazo[4,5-g]quinoxalin-6-one?
2-(5-nitrofuran-2-yl)-1-(2-phenylpropyl)-5H-imidazo[4,5-g]quinoxalin-6-one has a molecular weight of 415.41 g/mol, XLogP of 4.24, 5 rotatable bonds, 1 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(5-nitrofuran-2-yl)-1-(2-phenylpropyl)-5H-imidazo[4,5-g]quinoxalin-6-one is sourced from PubChem (CID 72948312), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).