C28H30FN7O3 — CID 72948323
N-[3-[[2-[3-fluoro-4-(4-methylpiperazin-1-yl)anilino]-5-(2-hydroxyethyl)-7H-pyrrolo[2,3-d]pyrimidin-4-yl]oxy]phenyl]prop-2-enamide (PubChem CID 72948323) has the molecular formula C28H30FN7O3 and a molecular weight of 531.59 g/mol. Its IUPAC name is N-[3-[[2-[3-fluoro-4-(4-methylpiperazin-1-yl)anilino]-5-(2-hydroxyethyl)-7H-pyrrolo[2,3-d]pyrimidin-4-yl]oxy]phenyl]prop-2-enamide.
| Compound Name | N-[3-[[2-[3-fluoro-4-(4-methylpiperazin-1-yl)anilino]-5-(2-hydroxyethyl)-7H-pyrrolo[2,3-d]pyrimidin-4-yl]oxy]phenyl]prop-2-enamide |
|---|---|
| PubChem CID | 72948323 |
| Molecular Formula | C28H30FN7O3 |
| Molecular Weight | 531.59 g/mol |
| Exact Mass | 531.24 |
| IUPAC Name | N-[3-[[2-[3-fluoro-4-(4-methylpiperazin-1-yl)anilino]-5-(2-hydroxyethyl)-7H-pyrrolo[2,3-d]pyrimidin-4-yl]oxy]phenyl]prop-2-enamide |
| SMILES | C=CC(=O)Nc1cccc(Oc2nc(Nc3ccc(N4CCN(C)CC4)c(F)c3)nc3[nH]cc(CCO)c23)c1 |
| InChI | InChI=1S/C28H30FN7O3/c1-3-24(38)31-19-5-4-6-21(15-19)39-27-25-18(9-14-37)17-30-26(25)33-28(34-27)32-20-7-8-23(22(29)16-20)36-12-10-35(2)11-13-36/h3-8,15-17,37H,1,9-14H2,2H3,(H,31,38)(H2,30,32,33,34) |
| InChIKey | UAXPROIZGYSMOO-UHFFFAOYSA-N |
| XLogP | 4.04 |
| TPSA | 118.64 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 531.59 |
| LogP ≤ 5 | 4.04 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|