C24H18N2O4 — CID 72948644
4-(1,6,11-trioxo-3,4,5,12-tetrahydro-2H-benzo[b]acridin-12-yl)benzamide (PubChem CID 72948644) has the molecular formula C24H18N2O4 and a molecular weight of 398.42 g/mol. Its IUPAC name is 4-(1,6,11-trioxo-3,4,5,12-tetrahydro-2H-benzo[b]acridin-12-yl)benzamide.
| Compound Name | 4-(1,6,11-trioxo-3,4,5,12-tetrahydro-2H-benzo[b]acridin-12-yl)benzamide |
|---|---|
| PubChem CID | 72948644 |
| Molecular Formula | C24H18N2O4 |
| Molecular Weight | 398.42 g/mol |
| Exact Mass | 398.13 |
| IUPAC Name | 4-(1,6,11-trioxo-3,4,5,12-tetrahydro-2H-benzo[b]acridin-12-yl)benzamide |
| SMILES | NC(=O)c1ccc(C2C3=C(CCCC3=O)NC3=C2C(=O)c2ccccc2C3=O)cc1 |
| InChI | InChI=1S/C24H18N2O4/c25-24(30)13-10-8-12(9-11-13)18-19-16(6-3-7-17(19)27)26-21-20(18)22(28)14-4-1-2-5-15(14)23(21)29/h1-2,4-5,8-11,18,26H,3,6-7H2,(H2,25,30) |
| InChIKey | SBPRNULSOLQLNJ-UHFFFAOYSA-N |
| XLogP | 2.81 |
| TPSA | 106.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.42 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'} |
|---|