About 1-heptyl-2-(5-nitrofuran-2-yl)-7-propan-2-yl-5H-imidazo[4,5-g]quinoxalin-6-one
1-heptyl-2-(5-nitrofuran-2-yl)-7-propan-2-yl-5H-imidazo[4,5-g]quinoxalin-6-one (PubChem CID 72948677) has the molecular formula C23H27N5O4
and a molecular weight of 437.50 g/mol. Its IUPAC name is 1-heptyl-2-(5-nitrofuran-2-yl)-7-propan-2-yl-5H-imidazo[4,5-g]quinoxalin-6-one.
Molecular Properties
| Compound Name | 1-heptyl-2-(5-nitrofuran-2-yl)-7-propan-2-yl-5H-imidazo[4,5-g]quinoxalin-6-one |
| PubChem CID | 72948677 |
| Molecular Formula | C23H27N5O4 |
| Molecular Weight | 437.50 g/mol |
| Exact Mass | 437.21 |
| IUPAC Name | 1-heptyl-2-(5-nitrofuran-2-yl)-7-propan-2-yl-5H-imidazo[4,5-g]quinoxalin-6-one |
| SMILES | CCCCCCCn1c(-c2ccc([N+](=O)[O-])o2)nc2cc3[nH]c(=O)c(C(C)C)nc3cc21 |
| InChI | InChI=1S/C23H27N5O4/c1-4-5-6-7-8-11-27-18-13-16-15(26-23(29)21(24-16)14(2)3)12-17(18)25-22(27)19-9-10-20(32-19)28(30)31/h9-10,12-14H,4-8,11H2,1-3H3,(H,26,29) |
| InChIKey | UBGIELANXYEHLH-UHFFFAOYSA-N |
| XLogP | 5.53 |
| TPSA | 119.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 437.50 |
| LogP ≤ 5 | 5.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 1-heptyl-2-(5-nitrofuran-2-yl)-7-propan-2-yl-5H-imidazo[4,5-g]quinoxalin-6-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-heptyl-2-(5-nitrofuran-2-yl)-7-propan-2-yl-5H-imidazo[4,5-g]quinoxalin-6-one?
The IUPAC name of 1-heptyl-2-(5-nitrofuran-2-yl)-7-propan-2-yl-5H-imidazo[4,5-g]quinoxalin-6-one (CID 72948677) is 1-heptyl-2-(5-nitrofuran-2-yl)-7-propan-2-yl-5H-imidazo[4,5-g]quinoxalin-6-one.
What is the SMILES notation for 1-heptyl-2-(5-nitrofuran-2-yl)-7-propan-2-yl-5H-imidazo[4,5-g]quinoxalin-6-one?
The canonical SMILES for 1-heptyl-2-(5-nitrofuran-2-yl)-7-propan-2-yl-5H-imidazo[4,5-g]quinoxalin-6-one is CCCCCCCn1c(-c2ccc([N+](=O)[O-])o2)nc2cc3[nH]c(=O)c(C(C)C)nc3cc21.
What is the InChIKey of 1-heptyl-2-(5-nitrofuran-2-yl)-7-propan-2-yl-5H-imidazo[4,5-g]quinoxalin-6-one?
The InChIKey is UBGIELANXYEHLH-UHFFFAOYSA-N. The full InChI is InChI=1S/C23H27N5O4/c1-4-5-6-7-8-11-27-18-13-16-15(26-23(29)21(24-16)14(2)3)12-17(18)25-22(27)19-9-10-20(32-19)28(30)31/h9-10,12-14H,4-8,11H2,1-3H3,(H,26,29).
What are the key properties of 1-heptyl-2-(5-nitrofuran-2-yl)-7-propan-2-yl-5H-imidazo[4,5-g]quinoxalin-6-one?
1-heptyl-2-(5-nitrofuran-2-yl)-7-propan-2-yl-5H-imidazo[4,5-g]quinoxalin-6-one has a molecular weight of 437.50 g/mol, XLogP of 5.53, 9 rotatable bonds, 1 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for 1-heptyl-2-(5-nitrofuran-2-yl)-7-propan-2-yl-5H-imidazo[4,5-g]quinoxalin-6-one is sourced from PubChem (CID 72948677), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).