C28H29FN8O2 — CID 72948687
N-[3-[[5-(aziridin-1-yl)-2-[3-fluoro-4-(4-methylpiperazin-1-yl)anilino]-7H-pyrrolo[2,3-d]pyrimidin-4-yl]oxy]phenyl]prop-2-enamide (PubChem CID 72948687) has the molecular formula C28H29FN8O2 and a molecular weight of 528.59 g/mol. Its IUPAC name is N-[3-[[5-(aziridin-1-yl)-2-[3-fluoro-4-(4-methylpiperazin-1-yl)anilino]-7H-pyrrolo[2,3-d]pyrimidin-4-yl]oxy]phenyl]prop-2-enamide.
| Compound Name | N-[3-[[5-(aziridin-1-yl)-2-[3-fluoro-4-(4-methylpiperazin-1-yl)anilino]-7H-pyrrolo[2,3-d]pyrimidin-4-yl]oxy]phenyl]prop-2-enamide |
|---|---|
| PubChem CID | 72948687 |
| Molecular Formula | C28H29FN8O2 |
| Molecular Weight | 528.59 g/mol |
| Exact Mass | 528.24 |
| IUPAC Name | N-[3-[[5-(aziridin-1-yl)-2-[3-fluoro-4-(4-methylpiperazin-1-yl)anilino]-7H-pyrrolo[2,3-d]pyrimidin-4-yl]oxy]phenyl]prop-2-enamide |
| SMILES | C=CC(=O)Nc1cccc(Oc2nc(Nc3ccc(N4CCN(C)CC4)c(F)c3)nc3[nH]cc(N4CC4)c23)c1 |
| InChI | InChI=1S/C28H29FN8O2/c1-3-24(38)31-18-5-4-6-20(15-18)39-27-25-23(37-13-14-37)17-30-26(25)33-28(34-27)32-19-7-8-22(21(29)16-19)36-11-9-35(2)10-12-36/h3-8,15-17H,1,9-14H2,2H3,(H,31,38)(H2,30,32,33,34) |
| InChIKey | DERXCLHUGPTWMG-UHFFFAOYSA-N |
| XLogP | 4.33 |
| TPSA | 101.42 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 528.59 |
| LogP ≤ 5 | 4.33 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|