C21H25N7O3S — CID 72949031
4-[[4-(2-amino-1,3-thiazol-5-yl)-6-[(3S,5S)-3,5-dimethylmorpholin-4-yl]-1,3,5-triazin-2-yl]oxy]-N,N-dimethylbenzamide (PubChem CID 72949031) has the molecular formula C21H25N7O3S and a molecular weight of 455.54 g/mol. Its IUPAC name is 4-[[4-(2-amino-1,3-thiazol-5-yl)-6-[(3S,5S)-3,5-dimethylmorpholin-4-yl]-1,3,5-triazin-2-yl]oxy]-N,N-dimethylbenzamide.
| Compound Name | 4-[[4-(2-amino-1,3-thiazol-5-yl)-6-[(3S,5S)-3,5-dimethylmorpholin-4-yl]-1,3,5-triazin-2-yl]oxy]-N,N-dimethylbenzamide |
|---|---|
| PubChem CID | 72949031 |
| Molecular Formula | C21H25N7O3S |
| Molecular Weight | 455.54 g/mol |
| Exact Mass | 455.17 |
| IUPAC Name | 4-[[4-(2-amino-1,3-thiazol-5-yl)-6-[(3S,5S)-3,5-dimethylmorpholin-4-yl]-1,3,5-triazin-2-yl]oxy]-N,N-dimethylbenzamide |
| SMILES | C[C@H]1COC[C@H](C)N1c1nc(Oc2ccc(C(=O)N(C)C)cc2)nc(-c2cnc(N)s2)n1 |
| InChI | InChI=1S/C21H25N7O3S/c1-12-10-30-11-13(2)28(12)20-24-17(16-9-23-19(22)32-16)25-21(26-20)31-15-7-5-14(6-8-15)18(29)27(3)4/h5-9,12-13H,10-11H2,1-4H3,(H2,22,23)/t12-,13-/m0/s1 |
| InChIKey | PLJMSCIVANOIEI-STQMWFEESA-N |
| XLogP | 2.68 |
| TPSA | 119.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.54 |
| LogP ≤ 5 | 2.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |