C28H25N5O4 — CID 72949041
7-benzyl-1-[2-(cyclohexen-1-yl)ethyl]-2-(5-nitrofuran-2-yl)-5H-imidazo[4,5-g]quinoxalin-6-one (PubChem CID 72949041) has the molecular formula C28H25N5O4 and a molecular weight of 495.54 g/mol. Its IUPAC name is 7-benzyl-1-[2-(cyclohexen-1-yl)ethyl]-2-(5-nitrofuran-2-yl)-5H-imidazo[4,5-g]quinoxalin-6-one.
| Compound Name | 7-benzyl-1-[2-(cyclohexen-1-yl)ethyl]-2-(5-nitrofuran-2-yl)-5H-imidazo[4,5-g]quinoxalin-6-one |
|---|---|
| PubChem CID | 72949041 |
| Molecular Formula | C28H25N5O4 |
| Molecular Weight | 495.54 g/mol |
| Exact Mass | 495.19 |
| IUPAC Name | 7-benzyl-1-[2-(cyclohexen-1-yl)ethyl]-2-(5-nitrofuran-2-yl)-5H-imidazo[4,5-g]quinoxalin-6-one |
| SMILES | O=c1[nH]c2cc3nc(-c4ccc([N+](=O)[O-])o4)n(CCC4=CCCCC4)c3cc2nc1Cc1ccccc1 |
| InChI | InChI=1S/C28H25N5O4/c34-28-23(15-19-9-5-2-6-10-19)29-21-17-24-22(16-20(21)31-28)30-27(25-11-12-26(37-25)33(35)36)32(24)14-13-18-7-3-1-4-8-18/h2,5-7,9-12,16-17H,1,3-4,8,13-15H2,(H,31,34) |
| InChIKey | LFLCAAKKKCKBJY-UHFFFAOYSA-N |
| XLogP | 5.92 |
| TPSA | 119.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 495.54 |
| LogP ≤ 5 | 5.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|