C26H26FN5O6 — CID 72949043
4-fluoro-N-[1-(3-methoxypropyl)-6-morpholin-4-yl-2-(5-nitrofuran-2-yl)benzimidazol-5-yl]benzamide (PubChem CID 72949043) has the molecular formula C26H26FN5O6 and a molecular weight of 523.52 g/mol. Its IUPAC name is 4-fluoro-N-[1-(3-methoxypropyl)-6-morpholin-4-yl-2-(5-nitrofuran-2-yl)benzimidazol-5-yl]benzamide.
| Compound Name | 4-fluoro-N-[1-(3-methoxypropyl)-6-morpholin-4-yl-2-(5-nitrofuran-2-yl)benzimidazol-5-yl]benzamide |
|---|---|
| PubChem CID | 72949043 |
| Molecular Formula | C26H26FN5O6 |
| Molecular Weight | 523.52 g/mol |
| Exact Mass | 523.19 |
| IUPAC Name | 4-fluoro-N-[1-(3-methoxypropyl)-6-morpholin-4-yl-2-(5-nitrofuran-2-yl)benzimidazol-5-yl]benzamide |
| SMILES | COCCCn1c(-c2ccc([N+](=O)[O-])o2)nc2cc(NC(=O)c3ccc(F)cc3)c(N3CCOCC3)cc21 |
| InChI | InChI=1S/C26H26FN5O6/c1-36-12-2-9-31-22-16-21(30-10-13-37-14-11-30)19(29-26(33)17-3-5-18(27)6-4-17)15-20(22)28-25(31)23-7-8-24(38-23)32(34)35/h3-8,15-16H,2,9-14H2,1H3,(H,29,33) |
| InChIKey | BLVLQNMJXUKOFT-UHFFFAOYSA-N |
| XLogP | 4.47 |
| TPSA | 124.90 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 523.52 |
| LogP ≤ 5 | 4.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|