C22H33F2NO4 — CID 72949379
methyl 7-[(5R)-3,3-difluoro-5-[(E,3R,4S)-3-hydroxy-4-methylnon-1-en-6-ynyl]-2-oxopyrrolidin-1-yl]heptanoate (PubChem CID 72949379) has the molecular formula C22H33F2NO4 and a molecular weight of 413.51 g/mol. Its IUPAC name is methyl 7-[(5R)-3,3-difluoro-5-[(E,3R,4S)-3-hydroxy-4-methylnon-1-en-6-ynyl]-2-oxopyrrolidin-1-yl]heptanoate.
| Compound Name | methyl 7-[(5R)-3,3-difluoro-5-[(E,3R,4S)-3-hydroxy-4-methylnon-1-en-6-ynyl]-2-oxopyrrolidin-1-yl]heptanoate |
|---|---|
| PubChem CID | 72949379 |
| Molecular Formula | C22H33F2NO4 |
| Molecular Weight | 413.51 g/mol |
| Exact Mass | 413.24 |
| IUPAC Name | methyl 7-[(5R)-3,3-difluoro-5-[(E,3R,4S)-3-hydroxy-4-methylnon-1-en-6-ynyl]-2-oxopyrrolidin-1-yl]heptanoate |
| SMILES | CCC#CC[C@H](C)[C@@H](O)/C=C/[C@H]1CC(F)(F)C(=O)N1CCCCCCC(=O)OC |
| InChI | InChI=1S/C22H33F2NO4/c1-4-5-8-11-17(2)19(26)14-13-18-16-22(23,24)21(28)25(18)15-10-7-6-9-12-20(27)29-3/h13-14,17-19,26H,4,6-7,9-12,15-16H2,1-3H3/b14-13+/t17-,18-,19-/m0/s1 |
| InChIKey | NNQOPMDJSKGOML-SNLJXXQOSA-N |
| XLogP | 3.70 |
| TPSA | 66.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.51 |
| LogP ≤ 5 | 3.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|