C17H14Cl2F5N3O5S — CID 72950465
5-chloro-4-[[5-chloro-6-(2,2,3,3-tetrafluoropropoxy)-3-pyridinyl]oxy]-N-(dimethylsulfamoyl)-2-fluorobenzamide (PubChem CID 72950465) has the molecular formula C17H14Cl2F5N3O5S and a molecular weight of 538.28 g/mol. Its IUPAC name is 5-chloro-4-[[5-chloro-6-(2,2,3,3-tetrafluoropropoxy)-3-pyridinyl]oxy]-N-(dimethylsulfamoyl)-2-fluorobenzamide.
| Compound Name | 5-chloro-4-[[5-chloro-6-(2,2,3,3-tetrafluoropropoxy)-3-pyridinyl]oxy]-N-(dimethylsulfamoyl)-2-fluorobenzamide |
|---|---|
| PubChem CID | 72950465 |
| Molecular Formula | C17H14Cl2F5N3O5S |
| Molecular Weight | 538.28 g/mol |
| Exact Mass | 537.00 |
| IUPAC Name | 5-chloro-4-[[5-chloro-6-(2,2,3,3-tetrafluoropropoxy)-3-pyridinyl]oxy]-N-(dimethylsulfamoyl)-2-fluorobenzamide |
| SMILES | CN(C)S(=O)(=O)NC(=O)c1cc(Cl)c(Oc2cnc(OCC(F)(F)C(F)F)c(Cl)c2)cc1F |
| InChI | InChI=1S/C17H14Cl2F5N3O5S/c1-27(2)33(29,30)26-14(28)9-4-10(18)13(5-12(9)20)32-8-3-11(19)15(25-6-8)31-7-17(23,24)16(21)22/h3-6,16H,7H2,1-2H3,(H,26,28) |
| InChIKey | UOURQUTWYWICIZ-UHFFFAOYSA-N |
| XLogP | 4.14 |
| TPSA | 97.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 538.28 |
| LogP ≤ 5 | 4.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|