C19H14F2N2O2S — CID 72950691
(1S,2R,3S)-1-fluoro-2-[2-(4-fluorophenyl)-1,3-thiazol-5-yl]-N-hydroxy-3-phenylcyclopropane-1-carboxamide (PubChem CID 72950691) has the molecular formula C19H14F2N2O2S and a molecular weight of 372.40 g/mol. Its IUPAC name is (1S,2R,3S)-1-fluoro-2-[2-(4-fluorophenyl)-1,3-thiazol-5-yl]-N-hydroxy-3-phenylcyclopropane-1-carboxamide.
| Compound Name | (1S,2R,3S)-1-fluoro-2-[2-(4-fluorophenyl)-1,3-thiazol-5-yl]-N-hydroxy-3-phenylcyclopropane-1-carboxamide |
|---|---|
| PubChem CID | 72950691 |
| Molecular Formula | C19H14F2N2O2S |
| Molecular Weight | 372.40 g/mol |
| Exact Mass | 372.07 |
| IUPAC Name | (1S,2R,3S)-1-fluoro-2-[2-(4-fluorophenyl)-1,3-thiazol-5-yl]-N-hydroxy-3-phenylcyclopropane-1-carboxamide |
| SMILES | O=C(NO)[C@]1(F)[C@H](c2ccccc2)[C@H]1c1cnc(-c2ccc(F)cc2)s1 |
| InChI | InChI=1S/C19H14F2N2O2S/c20-13-8-6-12(7-9-13)17-22-10-14(26-17)16-15(11-4-2-1-3-5-11)19(16,21)18(24)23-25/h1-10,15-16,25H,(H,23,24)/t15-,16-,19+/m1/s1 |
| InChIKey | QZEPBMKPUBUIIG-MDZRGWNJSA-N |
| XLogP | 4.04 |
| TPSA | 62.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.40 |
| LogP ≤ 5 | 4.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|