About 1-ethyl-1-(1H-1,2,4-triazol-5-yl)hydrazine
1-ethyl-1-(1H-1,2,4-triazol-5-yl)hydrazine (PubChem CID 72950781) has the molecular formula C4H9N5
and a molecular weight of 127.15 g/mol. Its IUPAC name is 1-ethyl-1-(1H-1,2,4-triazol-5-yl)hydrazine.
Molecular Properties
| Compound Name | 1-ethyl-1-(1H-1,2,4-triazol-5-yl)hydrazine |
| PubChem CID | 72950781 |
| Molecular Formula | C4H9N5 |
| Molecular Weight | 127.15 g/mol |
| Exact Mass | 127.09 |
| IUPAC Name | 1-ethyl-1-(1H-1,2,4-triazol-5-yl)hydrazine |
| SMILES | CCN(N)c1ncn[nH]1 |
| InChI | InChI=1S/C4H9N5/c1-2-9(5)4-6-3-7-8-4/h3H,2,5H2,1H3,(H,6,7,8) |
| InChIKey | WIPMEBWNMTYQDB-UHFFFAOYSA-N |
| XLogP | -0.50 |
| TPSA | 70.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 127.15 |
| LogP ≤ 5 | -0.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 1-ethyl-1-(1H-1,2,4-triazol-5-yl)hydrazine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-ethyl-1-(1H-1,2,4-triazol-5-yl)hydrazine?
The IUPAC name of 1-ethyl-1-(1H-1,2,4-triazol-5-yl)hydrazine (CID 72950781) is 1-ethyl-1-(1H-1,2,4-triazol-5-yl)hydrazine.
What is the SMILES notation for 1-ethyl-1-(1H-1,2,4-triazol-5-yl)hydrazine?
The canonical SMILES for 1-ethyl-1-(1H-1,2,4-triazol-5-yl)hydrazine is CCN(N)c1ncn[nH]1.
What is the InChIKey of 1-ethyl-1-(1H-1,2,4-triazol-5-yl)hydrazine?
The InChIKey is WIPMEBWNMTYQDB-UHFFFAOYSA-N. The full InChI is InChI=1S/C4H9N5/c1-2-9(5)4-6-3-7-8-4/h3H,2,5H2,1H3,(H,6,7,8).
What are the key properties of 1-ethyl-1-(1H-1,2,4-triazol-5-yl)hydrazine?
1-ethyl-1-(1H-1,2,4-triazol-5-yl)hydrazine has a molecular weight of 127.15 g/mol, XLogP of -0.50, 2 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1-ethyl-1-(1H-1,2,4-triazol-5-yl)hydrazine is sourced from PubChem (CID 72950781), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).