C29H30FN7O2 — CID 72950969
N-[3-[[5-cyclopropyl-2-[3-fluoro-4-(4-methylpiperazin-1-yl)anilino]-7H-pyrrolo[2,3-d]pyrimidin-4-yl]oxy]phenyl]prop-2-enamide (PubChem CID 72950969) has the molecular formula C29H30FN7O2 and a molecular weight of 527.60 g/mol. Its IUPAC name is N-[3-[[5-cyclopropyl-2-[3-fluoro-4-(4-methylpiperazin-1-yl)anilino]-7H-pyrrolo[2,3-d]pyrimidin-4-yl]oxy]phenyl]prop-2-enamide.
| Compound Name | N-[3-[[5-cyclopropyl-2-[3-fluoro-4-(4-methylpiperazin-1-yl)anilino]-7H-pyrrolo[2,3-d]pyrimidin-4-yl]oxy]phenyl]prop-2-enamide |
|---|---|
| PubChem CID | 72950969 |
| Molecular Formula | C29H30FN7O2 |
| Molecular Weight | 527.60 g/mol |
| Exact Mass | 527.24 |
| IUPAC Name | N-[3-[[5-cyclopropyl-2-[3-fluoro-4-(4-methylpiperazin-1-yl)anilino]-7H-pyrrolo[2,3-d]pyrimidin-4-yl]oxy]phenyl]prop-2-enamide |
| SMILES | C=CC(=O)Nc1cccc(Oc2nc(Nc3ccc(N4CCN(C)CC4)c(F)c3)nc3[nH]cc(C4CC4)c23)c1 |
| InChI | InChI=1S/C29H30FN7O2/c1-3-25(38)32-19-5-4-6-21(15-19)39-28-26-22(18-7-8-18)17-31-27(26)34-29(35-28)33-20-9-10-24(23(30)16-20)37-13-11-36(2)12-14-37/h3-6,9-10,15-18H,1,7-8,11-14H2,2H3,(H,32,38)(H2,31,33,34,35) |
| InChIKey | IYYZPLDHYBNXLH-UHFFFAOYSA-N |
| XLogP | 5.39 |
| TPSA | 98.41 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 527.60 |
| LogP ≤ 5 | 5.39 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|