About 6-hydroxytricyclo[3.2.1.02,7]octan-3-one
6-hydroxytricyclo[3.2.1.02,7]octan-3-one (PubChem CID 72951771) has the molecular formula C8H10O2
and a molecular weight of 138.17 g/mol. Its IUPAC name is 6-hydroxytricyclo[3.2.1.02,7]octan-3-one.
Molecular Properties
| Compound Name | 6-hydroxytricyclo[3.2.1.02,7]octan-3-one |
| PubChem CID | 72951771 |
| Molecular Formula | C8H10O2 |
| Molecular Weight | 138.17 g/mol |
| Exact Mass | 138.07 |
| IUPAC Name | 6-hydroxytricyclo[3.2.1.02,7]octan-3-one |
| SMILES | O=C1CC2CC3C1C3C2O |
| InChI | InChI=1S/C8H10O2/c9-5-2-3-1-4-6(5)7(4)8(3)10/h3-4,6-8,10H,1-2H2 |
| InChIKey | ZQRLHJNDJFEZJL-UHFFFAOYSA-N |
| XLogP | 0.20 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 138.17 |
| LogP ≤ 5 | 0.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 6-hydroxytricyclo[3.2.1.02,7]octan-3-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-hydroxytricyclo[3.2.1.02,7]octan-3-one?
The IUPAC name of 6-hydroxytricyclo[3.2.1.02,7]octan-3-one (CID 72951771) is 6-hydroxytricyclo[3.2.1.02,7]octan-3-one.
What is the SMILES notation for 6-hydroxytricyclo[3.2.1.02,7]octan-3-one?
The canonical SMILES for 6-hydroxytricyclo[3.2.1.02,7]octan-3-one is O=C1CC2CC3C1C3C2O.
What is the InChIKey of 6-hydroxytricyclo[3.2.1.02,7]octan-3-one?
The InChIKey is ZQRLHJNDJFEZJL-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H10O2/c9-5-2-3-1-4-6(5)7(4)8(3)10/h3-4,6-8,10H,1-2H2.
What are the key properties of 6-hydroxytricyclo[3.2.1.02,7]octan-3-one?
6-hydroxytricyclo[3.2.1.02,7]octan-3-one has a molecular weight of 138.17 g/mol, XLogP of 0.20, 0 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 6-hydroxytricyclo[3.2.1.02,7]octan-3-one is sourced from PubChem (CID 72951771), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).