C21H22FN3O6 — CID 72958408
3-[2-(3-benzamido-2-oxo-1-pyridinyl)butanoylamino]-5-fluoro-4-oxopentanoic acid (PubChem CID 72958408) has the molecular formula C21H22FN3O6 and a molecular weight of 431.42 g/mol. Its IUPAC name is 3-[2-(3-benzamido-2-oxo-1-pyridinyl)butanoylamino]-5-fluoro-4-oxopentanoic acid.
| Compound Name | 3-[2-(3-benzamido-2-oxo-1-pyridinyl)butanoylamino]-5-fluoro-4-oxopentanoic acid |
|---|---|
| PubChem CID | 72958408 |
| Molecular Formula | C21H22FN3O6 |
| Molecular Weight | 431.42 g/mol |
| Exact Mass | 431.15 |
| IUPAC Name | 3-[2-(3-benzamido-2-oxo-1-pyridinyl)butanoylamino]-5-fluoro-4-oxopentanoic acid |
| SMILES | CCC(C(=O)NC(CC(=O)O)C(=O)CF)n1cccc(NC(=O)c2ccccc2)c1=O |
| InChI | InChI=1S/C21H22FN3O6/c1-2-16(20(30)24-15(11-18(27)28)17(26)12-22)25-10-6-9-14(21(25)31)23-19(29)13-7-4-3-5-8-13/h3-10,15-16H,2,11-12H2,1H3,(H,23,29)(H,24,30)(H,27,28) |
| InChIKey | MYPRERWTTVXKPD-UHFFFAOYSA-N |
| XLogP | 1.55 |
| TPSA | 134.57 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.42 |
| LogP ≤ 5 | 1.55 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |