About 6-bromo-3-[(E)-N-(3,4-dimethylanilino)-C-methylcarbonimidoyl]chromen-2-one
6-bromo-3-[(E)-N-(3,4-dimethylanilino)-C-methylcarbonimidoyl]chromen-2-one (PubChem CID 7295867) has the molecular formula C19H17BrN2O2
and a molecular weight of 385.26 g/mol. Its IUPAC name is 6-bromo-3-[(E)-N-(3,4-dimethylanilino)-C-methylcarbonimidoyl]chromen-2-one.
Molecular Properties
| Compound Name | 6-bromo-3-[(E)-N-(3,4-dimethylanilino)-C-methylcarbonimidoyl]chromen-2-one |
| PubChem CID | 7295867 |
| Molecular Formula | C19H17BrN2O2 |
| Molecular Weight | 385.26 g/mol |
| Exact Mass | 384.05 |
| IUPAC Name | 6-bromo-3-[(E)-N-(3,4-dimethylanilino)-C-methylcarbonimidoyl]chromen-2-one |
| SMILES | C/C(=N\Nc1ccc(C)c(C)c1)c1cc2cc(Br)ccc2oc1=O |
| InChI | InChI=1S/C19H17BrN2O2/c1-11-4-6-16(8-12(11)2)22-21-13(3)17-10-14-9-15(20)5-7-18(14)24-19(17)23/h4-10,22H,1-3H3/b21-13+ |
| InChIKey | IRFOIHZVCUVKOV-FYJGNVAPSA-N |
| XLogP | 5.01 |
| TPSA | 54.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 385.26 |
| LogP ≤ 5 | 5.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 6-bromo-3-[(E)-N-(3,4-dimethylanilino)-C-methylcarbonimidoyl]chromen-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-bromo-3-[(E)-N-(3,4-dimethylanilino)-C-methylcarbonimidoyl]chromen-2-one?
The IUPAC name of 6-bromo-3-[(E)-N-(3,4-dimethylanilino)-C-methylcarbonimidoyl]chromen-2-one (CID 7295867) is 6-bromo-3-[(E)-N-(3,4-dimethylanilino)-C-methylcarbonimidoyl]chromen-2-one.
What is the SMILES notation for 6-bromo-3-[(E)-N-(3,4-dimethylanilino)-C-methylcarbonimidoyl]chromen-2-one?
The canonical SMILES for 6-bromo-3-[(E)-N-(3,4-dimethylanilino)-C-methylcarbonimidoyl]chromen-2-one is C/C(=N\Nc1ccc(C)c(C)c1)c1cc2cc(Br)ccc2oc1=O.
What is the InChIKey of 6-bromo-3-[(E)-N-(3,4-dimethylanilino)-C-methylcarbonimidoyl]chromen-2-one?
The InChIKey is IRFOIHZVCUVKOV-FYJGNVAPSA-N. The full InChI is InChI=1S/C19H17BrN2O2/c1-11-4-6-16(8-12(11)2)22-21-13(3)17-10-14-9-15(20)5-7-18(14)24-19(17)23/h4-10,22H,1-3H3/b21-13+.
What are the key properties of 6-bromo-3-[(E)-N-(3,4-dimethylanilino)-C-methylcarbonimidoyl]chromen-2-one?
6-bromo-3-[(E)-N-(3,4-dimethylanilino)-C-methylcarbonimidoyl]chromen-2-one has a molecular weight of 385.26 g/mol, XLogP of 5.01, 3 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 6-bromo-3-[(E)-N-(3,4-dimethylanilino)-C-methylcarbonimidoyl]chromen-2-one is sourced from PubChem (CID 7295867), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).