C16H25N3O4 — CID 7296221
N-[2-(1,2-oxazol-3-ylamino)-2-oxoethyl]-N-[[(2S)-oxolan-2-yl]methyl]hexanamide (PubChem CID 7296221) has the molecular formula C16H25N3O4 and a molecular weight of 323.39 g/mol. Its IUPAC name is N-[2-(1,2-oxazol-3-ylamino)-2-oxoethyl]-N-[[(2S)-oxolan-2-yl]methyl]hexanamide.
| Compound Name | N-[2-(1,2-oxazol-3-ylamino)-2-oxoethyl]-N-[[(2S)-oxolan-2-yl]methyl]hexanamide |
|---|---|
| PubChem CID | 7296221 |
| Molecular Formula | C16H25N3O4 |
| Molecular Weight | 323.39 g/mol |
| Exact Mass | 323.18 |
| IUPAC Name | N-[2-(1,2-oxazol-3-ylamino)-2-oxoethyl]-N-[[(2S)-oxolan-2-yl]methyl]hexanamide |
| SMILES | CCCCCC(=O)N(CC(=O)Nc1ccon1)C[C@@H]1CCCO1 |
| InChI | InChI=1S/C16H25N3O4/c1-2-3-4-7-16(21)19(11-13-6-5-9-22-13)12-15(20)17-14-8-10-23-18-14/h8,10,13H,2-7,9,11-12H2,1H3,(H,17,18,20)/t13-/m0/s1 |
| InChIKey | WMWUFECHDIESAG-ZDUSSCGKSA-N |
| XLogP | 2.20 |
| TPSA | 84.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.39 |
| LogP ≤ 5 | 2.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|