About CID 72964471
CID 72964471 (PubChem CID 72964471) has the molecular formula C14H12NO
and a molecular weight of 210.26 g/mol.
Molecular Properties
| Compound Name | CID 72964471 |
| PubChem CID | 72964471 |
| Molecular Formula | C14H12NO |
| Molecular Weight | 210.26 g/mol |
| Exact Mass | 210.09 |
| IUPAC Name | — |
| SMILES | [CH]1[CH][CH][C](C2=NC(c3ccccc3)CO2)[CH]1 |
| InChI | InChI=1S/C14H12NO/c1-2-6-11(7-3-1)13-10-16-14(15-13)12-8-4-5-9-12/h1-9,13H,10H2 |
| InChIKey | JIMDKTWPTBGNKU-UHFFFAOYSA-N |
| XLogP | 2.56 |
| TPSA | 21.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 210.26 |
| LogP ≤ 5 | 2.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze CID 72964471 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 72964471?
The IUPAC name of CID 72964471 (CID 72964471) is not available.
What is the SMILES notation for CID 72964471?
The canonical SMILES for CID 72964471 is [CH]1[CH][CH][C](C2=NC(c3ccccc3)CO2)[CH]1.
What is the InChIKey of CID 72964471?
The InChIKey is JIMDKTWPTBGNKU-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H12NO/c1-2-6-11(7-3-1)13-10-16-14(15-13)12-8-4-5-9-12/h1-9,13H,10H2.
What are the key properties of CID 72964471?
CID 72964471 has a molecular weight of 210.26 g/mol, XLogP of 2.56, 2 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for CID 72964471 is sourced from PubChem (CID 72964471), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).