C61H70O12 — CID 72964822
[3,4,5-tribenzoyloxy-6-[[6-(4-hydroxy-3-methylbutyl)-7,9,13-trimethyl-5-oxapentacyclo[10.8.0.02,9.04,8.013,18]icos-18-en-16-yl]oxy]oxan-2-yl]methyl benzoate (PubChem CID 72964822) has the molecular formula C61H70O12 and a molecular weight of 995.22 g/mol. Its IUPAC name is [3,4,5-tribenzoyloxy-6-[[6-(4-hydroxy-3-methylbutyl)-7,9,13-trimethyl-5-oxapentacyclo[10.8.0.02,9.04,8.013,18]icos-18-en-16-yl]oxy]oxan-2-yl]methyl benzoate.
| Compound Name | [3,4,5-tribenzoyloxy-6-[[6-(4-hydroxy-3-methylbutyl)-7,9,13-trimethyl-5-oxapentacyclo[10.8.0.02,9.04,8.013,18]icos-18-en-16-yl]oxy]oxan-2-yl]methyl benzoate |
|---|---|
| PubChem CID | 72964822 |
| Molecular Formula | C61H70O12 |
| Molecular Weight | 995.22 g/mol |
| Exact Mass | 994.49 |
| IUPAC Name | [3,4,5-tribenzoyloxy-6-[[6-(4-hydroxy-3-methylbutyl)-7,9,13-trimethyl-5-oxapentacyclo[10.8.0.02,9.04,8.013,18]icos-18-en-16-yl]oxy]oxan-2-yl]methyl benzoate |
| SMILES | CC(CO)CCC1OC2CC3C4CC=C5CC(OC6OC(COC(=O)c7ccccc7)C(OC(=O)c7ccccc7)C(OC(=O)c7ccccc7)C6OC(=O)c6ccccc6)CCC5(C)C4CCC3(C)C2C1C |
| InChI | InChI=1S/C61H70O12/c1-37(35-62)25-28-48-38(2)51-49(69-48)34-47-45-27-26-43-33-44(29-31-60(43,3)46(45)30-32-61(47,51)4)68-59-54(73-58(66)42-23-15-8-16-24-42)53(72-57(65)41-21-13-7-14-22-41)52(71-56(64)40-19-11-6-12-20-40)50(70-59)36-67-55(63)39-17-9-5-10-18-39/h5-24,26,37-38,44-54,59,62H,25,27-36H2,1-4H3 |
| InChIKey | ORMSJWMJRIXESI-UHFFFAOYSA-N |
| XLogP | 10.63 |
| TPSA | 153.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 73 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 995.22 |
| LogP ≤ 5 | 10.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|