C14H20O4Si — CID 72965758
1-ethenyl-3-(3-trimethylsilylprop-1-enyl)-1,3,3a,6a-tetrahydrofuro[3,4-c]furan-4,6-dione (PubChem CID 72965758) has the molecular formula C14H20O4Si and a molecular weight of 280.40 g/mol. Its IUPAC name is 1-ethenyl-3-(3-trimethylsilylprop-1-enyl)-1,3,3a,6a-tetrahydrofuro[3,4-c]furan-4,6-dione.
| Compound Name | 1-ethenyl-3-(3-trimethylsilylprop-1-enyl)-1,3,3a,6a-tetrahydrofuro[3,4-c]furan-4,6-dione |
|---|---|
| PubChem CID | 72965758 |
| Molecular Formula | C14H20O4Si |
| Molecular Weight | 280.40 g/mol |
| Exact Mass | 280.11 |
| IUPAC Name | 1-ethenyl-3-(3-trimethylsilylprop-1-enyl)-1,3,3a,6a-tetrahydrofuro[3,4-c]furan-4,6-dione |
| SMILES | C=CC1OC(C=CC[Si](C)(C)C)C2C(=O)OC(=O)C12 |
| InChI | InChI=1S/C14H20O4Si/c1-5-9-11-12(14(16)18-13(11)15)10(17-9)7-6-8-19(2,3)4/h5-7,9-12H,1,8H2,2-4H3 |
| InChIKey | TTWBVWZUYQCQBB-UHFFFAOYSA-N |
| XLogP | 2.15 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.40 |
| LogP ≤ 5 | 2.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|