C25H48O4Si — CID 72967436
methyl 9-[tert-butyl(dimethyl)silyl]oxy-10-hydroxyoctadeca-12,15-dienoate (PubChem CID 72967436) has the molecular formula C25H48O4Si and a molecular weight of 440.74 g/mol. Its IUPAC name is methyl 9-[tert-butyl(dimethyl)silyl]oxy-10-hydroxyoctadeca-12,15-dienoate.
| Compound Name | methyl 9-[tert-butyl(dimethyl)silyl]oxy-10-hydroxyoctadeca-12,15-dienoate |
|---|---|
| PubChem CID | 72967436 |
| Molecular Formula | C25H48O4Si |
| Molecular Weight | 440.74 g/mol |
| Exact Mass | 440.33 |
| IUPAC Name | methyl 9-[tert-butyl(dimethyl)silyl]oxy-10-hydroxyoctadeca-12,15-dienoate |
| SMILES | CCC=CCC=CCC(O)C(CCCCCCCC(=O)OC)O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C25H48O4Si/c1-8-9-10-11-13-16-19-22(26)23(29-30(6,7)25(2,3)4)20-17-14-12-15-18-21-24(27)28-5/h9-10,13,16,22-23,26H,8,11-12,14-15,17-21H2,1-7H3 |
| InChIKey | XABALNAETSCZGV-UHFFFAOYSA-N |
| XLogP | 6.94 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.74 |
| LogP ≤ 5 | 6.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|