C28H44O7 — CID 72967913
4,12-dihydroxy-8-[7-[3-(3-hydroxypentan-2-yl)oxiran-2-yl]-6-methylhepta-2,4-dien-2-yl]-7-methyl-1,9-dioxaspiro[2.11]tetradec-5-en-10-one (PubChem CID 72967913) has the molecular formula C28H44O7 and a molecular weight of 492.65 g/mol. Its IUPAC name is 4,12-dihydroxy-8-[7-[3-(3-hydroxypentan-2-yl)oxiran-2-yl]-6-methylhepta-2,4-dien-2-yl]-7-methyl-1,9-dioxaspiro[2.11]tetradec-5-en-10-one.
| Compound Name | 4,12-dihydroxy-8-[7-[3-(3-hydroxypentan-2-yl)oxiran-2-yl]-6-methylhepta-2,4-dien-2-yl]-7-methyl-1,9-dioxaspiro[2.11]tetradec-5-en-10-one |
|---|---|
| PubChem CID | 72967913 |
| Molecular Formula | C28H44O7 |
| Molecular Weight | 492.65 g/mol |
| Exact Mass | 492.31 |
| IUPAC Name | 4,12-dihydroxy-8-[7-[3-(3-hydroxypentan-2-yl)oxiran-2-yl]-6-methylhepta-2,4-dien-2-yl]-7-methyl-1,9-dioxaspiro[2.11]tetradec-5-en-10-one |
| SMILES | CCC(O)C(C)C1OC1CC(C)C=CC=C(C)C1OC(=O)CC(O)CCC2(CO2)C(O)C=CC1C |
| InChI | InChI=1S/C28H44O7/c1-6-22(30)20(5)27-23(34-27)14-17(2)8-7-9-18(3)26-19(4)10-11-24(31)28(16-33-28)13-12-21(29)15-25(32)35-26/h7-11,17,19-24,26-27,29-31H,6,12-16H2,1-5H3 |
| InChIKey | KHXVLFIIGDFCSQ-UHFFFAOYSA-N |
| XLogP | 3.47 |
| TPSA | 112.05 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 492.65 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|