C19H15N3O2 — CID 729709
(E)-2-cyano-N-(2-hydroxyphenyl)-3-(1-methylindol-3-yl)prop-2-enamide (PubChem CID 729709) has the molecular formula C19H15N3O2 and a molecular weight of 317.35 g/mol. Its IUPAC name is (E)-2-cyano-N-(2-hydroxyphenyl)-3-(1-methylindol-3-yl)prop-2-enamide.
| Compound Name | (E)-2-cyano-N-(2-hydroxyphenyl)-3-(1-methylindol-3-yl)prop-2-enamide |
|---|---|
| PubChem CID | 729709 |
| Molecular Formula | C19H15N3O2 |
| Molecular Weight | 317.35 g/mol |
| Exact Mass | 317.12 |
| IUPAC Name | (E)-2-cyano-N-(2-hydroxyphenyl)-3-(1-methylindol-3-yl)prop-2-enamide |
| SMILES | Cn1cc(/C=C(\C#N)C(=O)Nc2ccccc2O)c2ccccc21 |
| InChI | InChI=1S/C19H15N3O2/c1-22-12-14(15-6-2-4-8-17(15)22)10-13(11-20)19(24)21-16-7-3-5-9-18(16)23/h2-10,12,23H,1H3,(H,21,24)/b13-10+ |
| InChIKey | JERRNTIRXOVXGL-JLHYYAGUSA-N |
| XLogP | 3.43 |
| TPSA | 78.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.35 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|