C15H21NO2Si — CID 72974559
N-(1-hydroxy-3-phenylpropan-2-yl)-3-trimethylsilylprop-2-ynamide (PubChem CID 72974559) has the molecular formula C15H21NO2Si and a molecular weight of 275.42 g/mol. Its IUPAC name is N-(1-hydroxy-3-phenylpropan-2-yl)-3-trimethylsilylprop-2-ynamide.
| Compound Name | N-(1-hydroxy-3-phenylpropan-2-yl)-3-trimethylsilylprop-2-ynamide |
|---|---|
| PubChem CID | 72974559 |
| Molecular Formula | C15H21NO2Si |
| Molecular Weight | 275.42 g/mol |
| Exact Mass | 275.13 |
| IUPAC Name | N-(1-hydroxy-3-phenylpropan-2-yl)-3-trimethylsilylprop-2-ynamide |
| SMILES | C[Si](C)(C)C#CC(=O)NC(CO)Cc1ccccc1 |
| InChI | InChI=1S/C15H21NO2Si/c1-19(2,3)10-9-15(18)16-14(12-17)11-13-7-5-4-6-8-13/h4-8,14,17H,11-12H2,1-3H3,(H,16,18) |
| InChIKey | OBCOHAMMGGZWBA-UHFFFAOYSA-N |
| XLogP | 1.59 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.42 |
| LogP ≤ 5 | 1.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|