C22H24N4O2 — CID 72975600
2-[(4-acetylphenyl)diazenyl]-2-(2,3,3-trimethyl-4H-isoquinolin-1-ylidene)acetamide (PubChem CID 72975600) has the molecular formula C22H24N4O2 and a molecular weight of 376.46 g/mol. Its IUPAC name is 2-[(4-acetylphenyl)diazenyl]-2-(2,3,3-trimethyl-4H-isoquinolin-1-ylidene)acetamide.
| Compound Name | 2-[(4-acetylphenyl)diazenyl]-2-(2,3,3-trimethyl-4H-isoquinolin-1-ylidene)acetamide |
|---|---|
| PubChem CID | 72975600 |
| Molecular Formula | C22H24N4O2 |
| Molecular Weight | 376.46 g/mol |
| Exact Mass | 376.19 |
| IUPAC Name | 2-[(4-acetylphenyl)diazenyl]-2-(2,3,3-trimethyl-4H-isoquinolin-1-ylidene)acetamide |
| SMILES | CC(=O)c1ccc(/N=N/C(C(N)=O)=C2c3ccccc3CC(C)(C)N2C)cc1 |
| InChI | InChI=1S/C22H24N4O2/c1-14(27)15-9-11-17(12-10-15)24-25-19(21(23)28)20-18-8-6-5-7-16(18)13-22(2,3)26(20)4/h5-12H,13H2,1-4H3,(H2,23,28)/b20-19?,25-24+ |
| InChIKey | VEQRBCZWJQYGOS-LMKVZMFNSA-N |
| XLogP | 4.09 |
| TPSA | 88.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.46 |
| LogP ≤ 5 | 4.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|