C14H15F6N3O8 — CID 72976505
(2,5-dioxopyrrolidin-1-yl) 2,6-bis[(2,2,2-trifluoroacetyl)oxyamino]hexanoate (PubChem CID 72976505) has the molecular formula C14H15F6N3O8 and a molecular weight of 467.28 g/mol. Its IUPAC name is (2,5-dioxopyrrolidin-1-yl) 2,6-bis[(2,2,2-trifluoroacetyl)oxyamino]hexanoate.
| Compound Name | (2,5-dioxopyrrolidin-1-yl) 2,6-bis[(2,2,2-trifluoroacetyl)oxyamino]hexanoate |
|---|---|
| PubChem CID | 72976505 |
| Molecular Formula | C14H15F6N3O8 |
| Molecular Weight | 467.28 g/mol |
| Exact Mass | 467.08 |
| IUPAC Name | (2,5-dioxopyrrolidin-1-yl) 2,6-bis[(2,2,2-trifluoroacetyl)oxyamino]hexanoate |
| SMILES | O=C(ON1C(=O)CCC1=O)C(CCCCNOC(=O)C(F)(F)F)NOC(=O)C(F)(F)F |
| InChI | InChI=1S/C14H15F6N3O8/c15-13(16,17)11(27)29-21-6-2-1-3-7(22-30-12(28)14(18,19)20)10(26)31-23-8(24)4-5-9(23)25/h7,21-22H,1-6H2 |
| InChIKey | SMRASIHZHBBQOW-UHFFFAOYSA-N |
| XLogP | 0.35 |
| TPSA | 140.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 467.28 |
| LogP ≤ 5 | 0.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|