C50H46O15S — CID 72978058
[3,4,5-tribenzoyloxy-6-[[4-ethylsulfanyl-2-oxo-6-(phenylmethoxymethyl)-4,6,7,7a-tetrahydro-3aH-[1,3]dioxolo[4,5-c]pyran-7-yl]oxy]oxan-2-yl]methyl benzoate (PubChem CID 72978058) has the molecular formula C50H46O15S and a molecular weight of 918.97 g/mol. Its IUPAC name is [3,4,5-tribenzoyloxy-6-[[4-ethylsulfanyl-2-oxo-6-(phenylmethoxymethyl)-4,6,7,7a-tetrahydro-3aH-[1,3]dioxolo[4,5-c]pyran-7-yl]oxy]oxan-2-yl]methyl benzoate.
| Compound Name | [3,4,5-tribenzoyloxy-6-[[4-ethylsulfanyl-2-oxo-6-(phenylmethoxymethyl)-4,6,7,7a-tetrahydro-3aH-[1,3]dioxolo[4,5-c]pyran-7-yl]oxy]oxan-2-yl]methyl benzoate |
|---|---|
| PubChem CID | 72978058 |
| Molecular Formula | C50H46O15S |
| Molecular Weight | 918.97 g/mol |
| Exact Mass | 918.26 |
| IUPAC Name | [3,4,5-tribenzoyloxy-6-[[4-ethylsulfanyl-2-oxo-6-(phenylmethoxymethyl)-4,6,7,7a-tetrahydro-3aH-[1,3]dioxolo[4,5-c]pyran-7-yl]oxy]oxan-2-yl]methyl benzoate |
| SMILES | CCSC1OC(COCc2ccccc2)C(OC2OC(COC(=O)c3ccccc3)C(OC(=O)c3ccccc3)C(OC(=O)c3ccccc3)C2OC(=O)c2ccccc2)C2OC(=O)OC12 |
| InChI | InChI=1S/C50H46O15S/c1-2-66-49-43-41(64-50(55)65-43)39(36(59-49)29-56-28-31-18-8-3-9-19-31)63-48-42(62-47(54)35-26-16-7-17-27-35)40(61-46(53)34-24-14-6-15-25-34)38(60-45(52)33-22-12-5-13-23-33)37(58-48)30-57-44(51)32-20-10-4-11-21-32/h3-27,36-43,48-49H,2,28-30H2,1H3 |
| InChIKey | KQIIFLIOWGIBGR-UHFFFAOYSA-N |
| XLogP | 7.23 |
| TPSA | 177.65 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 16 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 66 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 918.97 |
| LogP ≤ 5 | 7.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 16 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|