C15H18ClN3O2S — CID 7298046
5-(2-chlorophenyl)-3-[[(2S,6S)-2,6-dimethylmorpholin-4-yl]methyl]-1,3,4-oxadiazole-2-thione (PubChem CID 7298046) has the molecular formula C15H18ClN3O2S and a molecular weight of 339.85 g/mol. Its IUPAC name is 5-(2-chlorophenyl)-3-[[(2S,6S)-2,6-dimethylmorpholin-4-yl]methyl]-1,3,4-oxadiazole-2-thione.
| Compound Name | 5-(2-chlorophenyl)-3-[[(2S,6S)-2,6-dimethylmorpholin-4-yl]methyl]-1,3,4-oxadiazole-2-thione |
|---|---|
| PubChem CID | 7298046 |
| Molecular Formula | C15H18ClN3O2S |
| Molecular Weight | 339.85 g/mol |
| Exact Mass | 339.08 |
| IUPAC Name | 5-(2-chlorophenyl)-3-[[(2S,6S)-2,6-dimethylmorpholin-4-yl]methyl]-1,3,4-oxadiazole-2-thione |
| SMILES | C[C@H]1CN(Cn2nc(-c3ccccc3Cl)oc2=S)C[C@H](C)O1 |
| InChI | InChI=1S/C15H18ClN3O2S/c1-10-7-18(8-11(2)20-10)9-19-15(22)21-14(17-19)12-5-3-4-6-13(12)16/h3-6,10-11H,7-9H2,1-2H3/t10-,11-/m0/s1 |
| InChIKey | WEFGLSFZGVCOSV-QWRGUYRKSA-N |
| XLogP | 3.59 |
| TPSA | 43.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.85 |
| LogP ≤ 5 | 3.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|